3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol
Internal ID | 33aecf41-b916-48f2-b416-b39cd7f59616 |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | 3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol |
SMILES (Canonical) | COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)OC)O |
SMILES (Isomeric) | COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)OC)O |
InChI | InChI=1S/C19H21NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3 |
InChI Key | JKPISQIIWUONPB-UHFFFAOYSA-N |
Popularity | 28 references in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 62.20 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 2.77 |
H-Bond Acceptor | 5 |
H-Bond Donor | 2 |
Rotatable Bonds | 2 |
16562-14-4 |
3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol |
CHEMBL595489 |
6H-Dibenzo[a,g]quinolizine-2,10-diol, 5,8,13,13a-tetrahydro-3,9-dimethoxy- |
13a-alpha-BERBINE-2,10-DIOL, 3,9-DIMETHOXY- |
Probes1_000256 |
Probes2_000298 |
SCHEMBL460434 |
CHEBI:91837 |
DTXSID00274461 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol 2D Structure of 3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol](https://plantaedb.com/storage/docs/compounds/2023/07/39-dimethoxy-681313a-tetrahydro-5h-isoquinolino21-bisoquinoline-210-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7394 | 73.94% |
Caco-2 | + | 0.7781 | 77.81% |
Blood Brain Barrier | + | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.8429 | 84.29% |
Subcellular localzation | Mitochondria | 0.7876 | 78.76% |
OATP2B1 inhibitior | - | 0.8542 | 85.42% |
OATP1B1 inhibitior | + | 0.9472 | 94.72% |
OATP1B3 inhibitior | + | 0.9481 | 94.81% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | + | 0.5500 | 55.00% |
BSEP inhibitior | - | 0.5560 | 55.60% |
P-glycoprotein inhibitior | - | 0.7128 | 71.28% |
P-glycoprotein substrate | + | 0.5055 | 50.55% |
CYP3A4 substrate | + | 0.5953 | 59.53% |
CYP2C9 substrate | + | 0.7825 | 78.25% |
CYP2D6 substrate | + | 0.8432 | 84.32% |
CYP3A4 inhibition | - | 0.8667 | 86.67% |
CYP2C9 inhibition | - | 0.9373 | 93.73% |
CYP2C19 inhibition | + | 0.6996 | 69.96% |
CYP2D6 inhibition | + | 0.8204 | 82.04% |
CYP1A2 inhibition | + | 0.8037 | 80.37% |
CYP2C8 inhibition | - | 0.5858 | 58.58% |
CYP inhibitory promiscuity | - | 0.7737 | 77.37% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6510 | 65.10% |
Eye corrosion | - | 0.9896 | 98.96% |
Eye irritation | - | 0.9368 | 93.68% |
Skin irritation | - | 0.7453 | 74.53% |
Skin corrosion | - | 0.9407 | 94.07% |
Ames mutagenesis | - | 0.6400 | 64.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4738 | 47.38% |
Micronuclear | + | 0.5300 | 53.00% |
Hepatotoxicity | - | 0.7375 | 73.75% |
skin sensitisation | - | 0.8909 | 89.09% |
Respiratory toxicity | + | 0.8556 | 85.56% |
Reproductive toxicity | + | 0.7889 | 78.89% |
Mitochondrial toxicity | + | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.7410 | 74.10% |
Acute Oral Toxicity (c) | III | 0.4885 | 48.85% |
Estrogen receptor binding | + | 0.5807 | 58.07% |
Androgen receptor binding | + | 0.5211 | 52.11% |
Thyroid receptor binding | + | 0.6127 | 61.27% |
Glucocorticoid receptor binding | + | 0.7301 | 73.01% |
Aromatase binding | - | 0.6827 | 68.27% |
PPAR gamma | + | 0.5473 | 54.73% |
Honey bee toxicity | - | 0.8769 | 87.69% |
Biodegradation | - | 0.9750 | 97.50% |
Crustacea aquatic toxicity | + | 0.6200 | 62.00% |
Fish aquatic toxicity | - | 0.3973 | 39.73% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4081 | P13726 | Coagulation factor III |
104.58 nM |
IC50 |
via Super-PRED
|
CHEMBL2056 | P21728 | Dopamine D1 receptor |
5.6 nM 3.4 nM 5.6 nM 135 nM |
Ki Ki Ki Ki |
PMID: 27032890
via Super-PRED via Super-PRED via Super-PRED |
CHEMBL217 | P14416 | Dopamine D2 receptor |
115.5 nM 11 nM 115.5 nM |
Ki Ki Ki |
PMID: 27032890
via Super-PRED via Super-PRED |
CHEMBL234 | P35462 | Dopamine D3 receptor |
101 nM 101 nM 30 nM |
Ki Ki Ki |
PMID: 27032890
via Super-PRED via Super-PRED |
CHEMBL1850 | P21918 | Dopamine D5 receptor |
4.4 nM |
Ki |
via Super-PRED
|
CHEMBL287 | Q99720 | Sigma opioid receptor |
269 nM 269 nM |
Ki Ki |
via Super-PRED
PMID: 27032890 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.59% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.17% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.82% | 93.40% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.21% | 91.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.01% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.76% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 91.33% | 98.75% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 90.53% | 88.48% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.47% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.90% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.95% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.85% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.59% | 85.14% |
CHEMBL5747 | Q92793 | CREB-binding protein | 85.45% | 95.12% |
CHEMBL2581 | P07339 | Cathepsin D | 85.19% | 98.95% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.85% | 91.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.62% | 90.00% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.32% | 82.38% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.80% | 99.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.62% | 93.99% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.04% | 95.89% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alphonsea lutea |
Annona glabra |
Cocculus laurifolius |
Desmos cochinchinensis |
Fibraurea recisa |
Liriodendron tulipifera |
Menispermum dauricum |
Pachygone ovata |
Sinomenium acutum |
PubChem | 5290 |
NPASS | NPC110416 |
ChEMBL | CHEMBL595489 |
LOTUS | LTS0242646 |
wikiData | Q7611023 |