1,6-Digalloyl-beta-D-glucopyranose
Internal ID | 2411378f-ac9a-4cce-a4c0-429baaccc821 |
Taxonomy | Phenylpropanoids and polyketides > Tannins |
IUPAC Name | [3,4,5-trihydroxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O |
InChI | InChI=1S/C20H20O14/c21-8-1-6(2-9(22)13(8)25)18(30)32-5-12-15(27)16(28)17(29)20(33-12)34-19(31)7-3-10(23)14(26)11(24)4-7/h1-4,12,15-17,20-29H,5H2 |
InChI Key | LYGRISUQIZNHGM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O14 |
Molecular Weight | 484.40 g/mol |
Exact Mass | 484.08530531 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | -0.80 |
[3,4,5-trihydroxy-6-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
Compound NP-007447 |
4-Quinoxaline mono-N-oxide |
SCHEMBL13430932 |
AKOS040739485 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.80% | 95.64% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.61% | 83.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.44% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.00% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.91% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.61% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.15% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.86% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.37% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.50% | 91.49% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.12% | 92.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.19% | 95.17% |
CHEMBL2581 | P07339 | Cathepsin D | 81.72% | 98.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.93% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 3332212 |
LOTUS | LTS0089653 |
wikiData | Q105159307 |