Veratramine
Internal ID | 37dd00b7-ac2b-439e-a0e9-0c12a6a305c3 |
Taxonomy | Benzenoids > Fluorenes |
IUPAC Name | (2S,3R,5S)-2-[(1S)-1-[(3S,6aR,11aS,11bR)-3-hydroxy-10,11b-dimethyl-1,2,3,4,6,6a,11,11a-octahydrobenzo[a]fluoren-9-yl]ethyl]-5-methylpiperidin-3-ol |
SMILES (Canonical) | CC1CC(C(NC1)C(C)C2=C(C3=C(C=C2)C4CC=C5CC(CCC5(C4C3)C)O)C)O |
SMILES (Isomeric) | C[C@H]1C[C@H]([C@@H](NC1)[C@@H](C)C2=C(C3=C(C=C2)[C@@H]4CC=C5C[C@H](CC[C@@]5([C@H]4C3)C)O)C)O |
InChI | InChI=1S/C27H39NO2/c1-15-11-25(30)26(28-14-15)17(3)20-7-8-21-22-6-5-18-12-19(29)9-10-27(18,4)24(22)13-23(21)16(20)2/h5,7-8,15,17,19,22,24-26,28-30H,6,9-14H2,1-4H3/t15-,17-,19-,22-,24-,25+,26-,27-/m0/s1 |
InChI Key | MALFODICFSIXPO-KFKQDBFTSA-N |
Popularity | 78 references in papers |
Molecular Formula | C27H39NO2 |
Molecular Weight | 409.60 g/mol |
Exact Mass | 409.298079487 g/mol |
Topological Polar Surface Area (TPSA) | 52.50 Ų |
XlogP | 4.30 |
Atomic LogP (AlogP) | 4.59 |
H-Bond Acceptor | 3 |
H-Bond Donor | 3 |
Rotatable Bonds | 2 |
60-70-8 |
NSC 17821 |
NSC 23880 |
(3beta,23beta)-14,15,16,17-Tetradehydroveratraman-3,23-diol |
HSDB 3545 |
NSC17821 |
NSC23880 |
BRN 0055515 |
UNII-RK363YG315 |
CHEBI:9951 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of Veratramine 2D Structure of Veratramine](https://plantaedb.com/storage/docs/compounds/2023/07/veratramine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9912 | 99.12% |
Caco-2 | - | 0.5161 | 51.61% |
Blood Brain Barrier | + | 0.6629 | 66.29% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.5643 | 56.43% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8928 | 89.28% |
OATP1B3 inhibitior | + | 0.9560 | 95.60% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.7000 | 70.00% |
BSEP inhibitior | + | 0.7141 | 71.41% |
P-glycoprotein inhibitior | - | 0.5000 | 50.00% |
P-glycoprotein substrate | + | 0.7237 | 72.37% |
CYP3A4 substrate | + | 0.7020 | 70.20% |
CYP2C9 substrate | - | 0.7928 | 79.28% |
CYP2D6 substrate | + | 0.6185 | 61.85% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9026 | 90.26% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | + | 0.7402 | 74.02% |
CYP inhibitory promiscuity | - | 0.8681 | 86.81% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9300 | 93.00% |
Carcinogenicity (trinary) | Non-required | 0.5794 | 57.94% |
Eye corrosion | - | 0.9900 | 99.00% |
Eye irritation | - | 0.9831 | 98.31% |
Skin irritation | - | 0.6936 | 69.36% |
Skin corrosion | - | 0.9051 | 90.51% |
Ames mutagenesis | - | 0.7000 | 70.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7910 | 79.10% |
Micronuclear | - | 0.6300 | 63.00% |
Hepatotoxicity | - | 0.5434 | 54.34% |
skin sensitisation | - | 0.7810 | 78.10% |
Respiratory toxicity | + | 0.7111 | 71.11% |
Reproductive toxicity | + | 0.9889 | 98.89% |
Mitochondrial toxicity | + | 0.9500 | 95.00% |
Nephrotoxicity | - | 0.8099 | 80.99% |
Acute Oral Toxicity (c) | III | 0.5723 | 57.23% |
Estrogen receptor binding | + | 0.6302 | 63.02% |
Androgen receptor binding | + | 0.6735 | 67.35% |
Thyroid receptor binding | + | 0.7081 | 70.81% |
Glucocorticoid receptor binding | + | 0.8067 | 80.67% |
Aromatase binding | + | 0.6054 | 60.54% |
PPAR gamma | + | 0.5746 | 57.46% |
Honey bee toxicity | - | 0.7793 | 77.93% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5800 | 58.00% |
Fish aquatic toxicity | + | 0.8458 | 84.58% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1914 | P06276 | Butyrylcholinesterase |
19460 nM |
IC50 |
PMID: 23062825
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.90% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.71% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 96.66% | 97.79% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.34% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.19% | 96.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 95.15% | 89.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.88% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.88% | 93.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.44% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.36% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.64% | 93.99% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.10% | 97.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.62% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.52% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.46% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.15% | 90.71% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.75% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.43% | 93.03% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 85.83% | 95.92% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.80% | 89.67% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.49% | 95.93% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.08% | 90.08% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.76% | 89.62% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.53% | 92.88% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.22% | 89.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.01% | 100.00% |
CHEMBL3920 | Q04759 | Protein kinase C theta | 81.85% | 97.69% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 81.58% | 90.71% |
CHEMBL238 | Q01959 | Dopamine transporter | 81.40% | 95.88% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.27% | 95.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.56% | 91.03% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.44% | 95.69% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.12% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6070 |
NPASS | NPC40488 |
ChEMBL | CHEMBL464724 |
LOTUS | LTS0217085 |
wikiData | Q15427945 |