Torachrysone 8-glucoside
Internal ID | 92e14261-0513-4c34-bbb4-56868fac816c |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1-[1-hydroxy-6-methoxy-3-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
SMILES (Canonical) | CC1=CC2=CC(=CC(=C2C(=C1C(=O)C)O)OC3C(C(C(C(O3)CO)O)O)O)OC |
SMILES (Isomeric) | CC1=CC2=CC(=CC(=C2C(=C1C(=O)C)O)OC3C(C(C(C(O3)CO)O)O)O)OC |
InChI | InChI=1S/C20H24O9/c1-8-4-10-5-11(27-3)6-12(15(10)17(24)14(8)9(2)22)28-20-19(26)18(25)16(23)13(7-21)29-20/h4-6,13,16,18-21,23-26H,7H2,1-3H3 |
InChI Key | GHKWPHRULCFTBB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O9 |
Molecular Weight | 408.40 g/mol |
Exact Mass | 408.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 1.20 |
1-[1-Hydroxy-6-methoxy-3-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
Torachrysone 8-O-beta-D-glucoside; Torachrysone-8-O-beta-D-glucopyranoside |
CHEBI:168095 |
1-[1-hydroxy-6-methoxy-3-methyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphthalen-2-yl]ethanone |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.96% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.25% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.70% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.43% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.96% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.21% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.17% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.44% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.44% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.13% | 97.36% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.24% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.03% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.57% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.09% | 95.56% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.10% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum australe |
Rheum palmatum |
Rumex hastatus |
Rumex nepalensis |
Rumex patientia |
Senna alexandrina |
PubChem | 14345578 |
LOTUS | LTS0096820 |
wikiData | Q105008594 |