Subavenoside E
Internal ID | edb7a906-081e-4011-a9a7-ed2f0f690eb9 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[[5,13-dimethoxy-8-(methoxymethyl)-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,8,12,14-heptaenyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COCC1=CCC2=C(C=CC(=C2)OC)C3=CC(=C(C=C13)OC)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COCC1=CCC2=C(C=CC(=C2)OC)C3=CC(=C(C=C13)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C25H30O9/c1-30-12-14-5-4-13-8-15(31-2)6-7-16(13)18-10-20(19(32-3)9-17(14)18)33-25-24(29)23(28)22(27)21(11-26)34-25/h5-10,21-29H,4,11-12H2,1-3H3/t21-,22-,23+,24-,25-/m1/s1 |
InChI Key | OZQFFZHCPIKJER-NHTNDUFYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H30O9 |
Molecular Weight | 474.50 g/mol |
Exact Mass | 474.18898253 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 1.30 |
CHEMBL2152484 |
2-(beta-D-Glucopyranosyloxy)-3,9-dimethoxy-5-(methoxymethyl)-7H-dibenzo[a,c]cycloheptene |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.50% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.41% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 96.21% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.14% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.37% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.08% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.82% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.18% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.41% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.36% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.15% | 92.94% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.95% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.12% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.53% | 89.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.49% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.44% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.44% | 94.73% |
CHEMBL5747 | Q92793 | CREB-binding protein | 82.77% | 95.12% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.04% | 97.36% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.96% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.33% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 71451248 |
NPASS | NPC76871 |
ChEMBL | CHEMBL2152484 |
LOTUS | LTS0176079 |
wikiData | Q105204030 |