Sophoflavescenol
Internal ID | 1cf1bde5-cc17-4607-8132-61e9aa796ec0 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 8-prenylated flavones |
IUPAC Name | 3,7-dihydroxy-2-(4-hydroxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
SMILES (Canonical) | CC(=CCC1=C2C(=C(C=C1O)OC)C(=O)C(=C(O2)C3=CC=C(C=C3)O)O)C |
SMILES (Isomeric) | CC(=CCC1=C2C(=C(C=C1O)OC)C(=O)C(=C(O2)C3=CC=C(C=C3)O)O)C |
InChI | InChI=1S/C21H20O6/c1-11(2)4-9-14-15(23)10-16(26-3)17-18(24)19(25)20(27-21(14)17)12-5-7-13(22)8-6-12/h4-8,10,22-23,25H,9H2,1-3H3 |
InChI Key | VMLJAWUWVVHRNG-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C21H20O6 |
Molecular Weight | 368.40 g/mol |
Exact Mass | 368.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 4.20 |
216450-65-6 |
CHEMBL77651 |
3,7-dihydroxy-2-(4-hydroxyphenyl)-5-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
D00QCL |
SCHEMBL14563970 |
BCP24815 |
HY-N2284 |
BDBM50116711 |
LMPK12112538 |
AKOS032945037 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.09% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.62% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.22% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.15% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.57% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.98% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.92% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.85% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 87.85% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.33% | 95.56% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.38% | 95.64% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.92% | 98.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.15% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.83% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.76% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.95% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.90% | 96.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.29% | 97.28% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.49% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 9929189 |
NPASS | NPC216538 |
ChEMBL | CHEMBL77651 |
LOTUS | LTS0217969 |
wikiData | Q104399812 |