1-Hydroxy-3-methoxy-6-methyl-8-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)anthracene-9,10-dione
Internal ID | f0fb9279-9305-4005-9eec-ecbdf1087aff |
Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
IUPAC Name | 1-hydroxy-3-methoxy-6-methyl-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-9,10-dione |
SMILES (Canonical) | CC1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2=O)C=C(C=C4O)OC |
SMILES (Isomeric) | CC1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2=O)C=C(C=C4O)OC |
InChI | InChI=1S/C22H22O10/c1-8-3-10-16(19(27)15-11(17(10)25)5-9(30-2)6-12(15)24)13(4-8)31-22-21(29)20(28)18(26)14(7-23)32-22/h3-6,14,18,20-24,26,28-29H,7H2,1-2H3 |
InChI Key | WLXGUTUUWXVZNM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O10 |
Molecular Weight | 446.40 g/mol |
Exact Mass | 446.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | 1.20 |
BBA29654 |
AKOS032947818 |
FT-0771552 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.59% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.95% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.77% | 96.21% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.44% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.18% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.13% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.03% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.51% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.54% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.62% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.99% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.34% | 97.36% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.30% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.76% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.20% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.93% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.10% | 93.18% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.92% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.06% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum australe |
Rheum palmatum |
Senna obtusifolia |
Senna occidentalis |
PubChem | 13084798 |
LOTUS | LTS0184454 |
wikiData | Q105308318 |