O-Methylbufotenine
| Internal ID | fc5306c7-dc79-47e2-b45f-cf21bd7a348a |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Tryptamines and derivatives |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H18N2O/c1-15(2)7-6-10-9-14-13-5-4-11(16-3)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3 |
| InChI Key | ZSTKHSQDNIGFLM-UHFFFAOYSA-N |
| Popularity | 817 references in papers |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.141913202 g/mol |
| Topological Polar Surface Area (TPSA) | 28.30 Ų |
| XlogP | 1.50 |
| Atomic LogP (AlogP) | 2.28 |
| H-Bond Acceptor | 2 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 4 |
| 5-Methoxy-N,N-dimethyltryptamine |
| 1019-45-0 |
| O-Methylbufotenine |
| 5-MeO-DMT |
| MeODMT |
| Methylbufotenine |
| Bufotenine, O-methyl- |
| 3-(2-Dimethylaminoethyl)-5-methoxyindole |
| 2-(5-Methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| 1H-Indole-3-ethanamine, 5-methoxy-N,N-dimethyl- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9938 | 99.38% |
| Caco-2 | + | 0.8362 | 83.62% |
| Blood Brain Barrier | + | 0.8500 | 85.00% |
| Human oral bioavailability | + | 0.5571 | 55.71% |
| Subcellular localzation | Mitochondria | 0.6836 | 68.36% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9245 | 92.45% |
| OATP1B3 inhibitior | + | 0.9426 | 94.26% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | + | 0.6250 | 62.50% |
| BSEP inhibitior | - | 0.6342 | 63.42% |
| P-glycoprotein inhibitior | - | 0.9672 | 96.72% |
| P-glycoprotein substrate | + | 0.5557 | 55.57% |
| CYP3A4 substrate | + | 0.5965 | 59.65% |
| CYP2C9 substrate | - | 0.6000 | 60.00% |
| CYP2D6 substrate | + | 0.8005 | 80.05% |
| CYP3A4 inhibition | - | 0.8310 | 83.10% |
| CYP2C9 inhibition | - | 0.9071 | 90.71% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | + | 0.5319 | 53.19% |
| CYP1A2 inhibition | + | 0.9106 | 91.06% |
| CYP2C8 inhibition | - | 0.9295 | 92.95% |
| CYP inhibitory promiscuity | - | 0.6555 | 65.55% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.6572 | 65.72% |
| Eye corrosion | - | 0.9886 | 98.86% |
| Eye irritation | - | 0.7082 | 70.82% |
| Skin irritation | - | 0.7063 | 70.63% |
| Skin corrosion | - | 0.8099 | 80.99% |
| Ames mutagenesis | - | 0.6200 | 62.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7844 | 78.44% |
| Micronuclear | - | 0.5200 | 52.00% |
| Hepatotoxicity | - | 0.8500 | 85.00% |
| skin sensitisation | - | 0.8722 | 87.22% |
| Respiratory toxicity | + | 0.9444 | 94.44% |
| Reproductive toxicity | + | 0.7556 | 75.56% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | - | 0.9312 | 93.12% |
| Acute Oral Toxicity (c) | III | 0.5490 | 54.90% |
| Estrogen receptor binding | - | 0.5587 | 55.87% |
| Androgen receptor binding | - | 0.8367 | 83.67% |
| Thyroid receptor binding | - | 0.5000 | 50.00% |
| Glucocorticoid receptor binding | - | 0.6012 | 60.12% |
| Aromatase binding | + | 0.5542 | 55.42% |
| PPAR gamma | - | 0.7692 | 76.92% |
| Honey bee toxicity | - | 0.8867 | 88.67% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.6400 | 64.00% |
| Fish aquatic toxicity | - | 0.4139 | 41.39% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
15848.93 nM |
AC50 |
via CMAUP
|
| CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
39810.7 nM |
Potency |
via CMAUP
|
| CHEMBL289 | P10635 | Cytochrome P450 2D6 |
19952.6 nM |
Potency |
via CMAUP
|
| CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
31622.8 nM |
Potency |
via CMAUP
|
| CHEMBL1945 | P48039 | Melatonin receptor 1A |
210 nM 210 nM |
Ki Ki |
via Super-PRED
PMID: 26023814 |
| CHEMBL1946 | P49286 | Melatonin receptor 1B |
16 nM 16 nM |
Ki Ki |
via Super-PRED
PMID: 26023814 |
| CHEMBL214 | P08908 | Serotonin 1a (5-HT1a) receptor |
197 nM 15 nM |
EC50 IC50 |
via Super-PRED
PMID: 1447752 |
| CHEMBL1898 | P28222 | Serotonin 1b (5-HT1b) receptor |
550 nM |
IC50 |
PMID: 1447752
|
| CHEMBL1983 | P28221 | Serotonin 1d (5-HT1d) receptor |
49 nM |
IC50 |
PMID: 1433172
|
| CHEMBL224 | P28223 | Serotonin 2a (5-HT2a) receptor |
15 nM 15 nM 15 nM |
Ki Ki Ki |
PMID: 16392816
PMID: 8027974 via Super-PRED |
| CHEMBL1833 | P41595 | Serotonin 2b (5-HT2b) receptor |
52 nM 52 nM |
Ki Ki |
PMID: 16392816
via Super-PRED |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor |
42 nM 250 nM |
Ki IC50 |
via Super-PRED
PMID: 1433172 |
| CHEMBL3371 | P50406 | Serotonin 6 (5-HT6) receptor |
13 nM 13 nM 16 nM 16 nM |
Ki Ki Ki Ki |
via Super-PRED
PMID: 16945532 PMID: 12825922 PMID: 11055342 |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor |
30 nM |
Ki |
PMID: 12825922
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.43% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.78% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.60% | 93.99% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 95.50% | 90.71% |
| CHEMBL240 | Q12809 | HERG | 94.39% | 89.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.68% | 98.59% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.67% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.60% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.59% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.17% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.40% | 93.31% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.11% | 85.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.74% | 90.00% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 84.35% | 85.30% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.84% | 93.24% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.49% | 93.18% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 82.47% | 89.44% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.15% | 96.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.95% | 80.96% |
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 81.37% | 96.11% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.11% | 95.48% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.98% | 96.67% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.82% | 82.86% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 80.16% | 89.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anadenanthera peregrina |
| Arundo donax |
| Horsfieldia superba |
| Lespedeza bicolor |
| Phalaris aquatica |
| Phyllodium pulchellum |
| Pleurolobus gangeticus |
| Senna alexandrina |
| Tetradium ruticarpum |
| Virola peruviana |
| PubChem | 1832 |
| NPASS | NPC92111 |
| ChEMBL | CHEMBL7257 |
| LOTUS | LTS0217945 |
| wikiData | Q570757 |