N-Methyllaurotetanine; NSC 247506; NSC 247564
Internal ID | 16e5c432-40e7-419c-a39a-a90057568b49 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-9-ol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)O)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)O)OC)OC |
InChI | InChI=1S/C20H23NO4/c1-21-6-5-11-9-17(24-3)20(25-4)19-13-10-16(23-2)15(22)8-12(13)7-14(21)18(11)19/h8-10,14,22H,5-7H2,1-4H3 |
InChI Key | ZFLRVRLYWHNAEC-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C20H23NO4 |
Molecular Weight | 341.40 g/mol |
Exact Mass | 341.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 3.00 |
Atomic LogP (AlogP) | 3.17 |
H-Bond Acceptor | 5 |
H-Bond Donor | 1 |
Rotatable Bonds | 3 |
1,2,10-Trimethoxy-6a-.alpha.-aporphin-9-ol |
N-Methyllaurotetanine; NSC 247506; NSC 247564 |
(+)-N-Methyl laurotetanine |
SCHEMBL4854015 |
CHEMBL4060658 |
ZFLRVRLYWHNAEC-UHFFFAOYSA-N |
FT-0697082 |
6a-.alpha.-Aporphin-9-ol, 1,2,10-trimethoxy- |
B0005-189367 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8819 | 88.19% |
Caco-2 | + | 0.9035 | 90.35% |
Blood Brain Barrier | + | 0.7000 | 70.00% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.5850 | 58.50% |
OATP2B1 inhibitior | - | 0.8565 | 85.65% |
OATP1B1 inhibitior | + | 0.9343 | 93.43% |
OATP1B3 inhibitior | + | 0.9497 | 94.97% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | + | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.6038 | 60.38% |
P-glycoprotein inhibitior | - | 0.8474 | 84.74% |
P-glycoprotein substrate | - | 0.7625 | 76.25% |
CYP3A4 substrate | + | 0.6135 | 61.35% |
CYP2C9 substrate | + | 0.7825 | 78.25% |
CYP2D6 substrate | + | 0.8432 | 84.32% |
CYP3A4 inhibition | - | 0.8310 | 83.10% |
CYP2C9 inhibition | - | 0.9083 | 90.83% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | + | 0.8238 | 82.38% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.7089 | 70.89% |
CYP inhibitory promiscuity | - | 0.9392 | 93.92% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.7108 | 71.08% |
Eye corrosion | - | 0.9922 | 99.22% |
Eye irritation | - | 0.9582 | 95.82% |
Skin irritation | - | 0.7431 | 74.31% |
Skin corrosion | - | 0.9323 | 93.23% |
Ames mutagenesis | + | 0.6100 | 61.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7125 | 71.25% |
Micronuclear | - | 0.5600 | 56.00% |
Hepatotoxicity | - | 0.7949 | 79.49% |
skin sensitisation | - | 0.9000 | 90.00% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.6000 | 60.00% |
Nephrotoxicity | - | 0.9012 | 90.12% |
Acute Oral Toxicity (c) | III | 0.7730 | 77.30% |
Estrogen receptor binding | + | 0.5964 | 59.64% |
Androgen receptor binding | - | 0.6027 | 60.27% |
Thyroid receptor binding | + | 0.6256 | 62.56% |
Glucocorticoid receptor binding | + | 0.7717 | 77.17% |
Aromatase binding | - | 0.5251 | 52.51% |
PPAR gamma | + | 0.6654 | 66.54% |
Honey bee toxicity | - | 0.8891 | 88.91% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
Fish aquatic toxicity | + | 0.8882 | 88.82% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2056 | P21728 | Dopamine D1 receptor |
373 nM |
Ki |
via Super-PRED
|
CHEMBL214 | P08908 | Serotonin 1a (5-HT1a) receptor |
85 nM |
Ki |
via Super-PRED
|
CHEMBL1833 | P41595 | Serotonin 2b (5-HT2b) receptor |
323 nM |
Ki |
via Super-PRED
|
CHEMBL3426 | P47898 | Serotonin 5a (5-HT5a) receptor |
566 nM |
Ki |
via Super-PRED
|
CHEMBL3371 | P50406 | Serotonin 6 (5-HT6) receptor |
306 nM |
Ki |
via Super-PRED
|
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor |
20 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.15% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 98.09% | 95.62% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.11% | 91.79% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 91.70% | 88.48% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.38% | 95.56% |
CHEMBL5747 | Q92793 | CREB-binding protein | 90.78% | 95.12% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.45% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.43% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.28% | 85.14% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.24% | 91.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.63% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 87.11% | 98.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.57% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.28% | 86.33% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.19% | 89.62% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.15% | 82.38% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.85% | 93.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.56% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.53% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.50% | 94.00% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 84.32% | 96.86% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.31% | 99.17% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 84.15% | 96.76% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.12% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.16% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 631015 |
NPASS | NPC66396 |
LOTUS | LTS0151189 |
wikiData | Q105018357 |