Methyl arachidate
| Internal ID | 5fade01a-0d81-4b5f-9e5f-61c220c5d11b |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Fatty acid methyl esters |
| IUPAC Name | methyl icosanoate |
| SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCC(=O)OC |
| SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C21H42O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h3-20H2,1-2H3 |
| InChI Key | QGBRLVONZXHAKJ-UHFFFAOYSA-N |
| Popularity | 270 references in papers |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.318480578 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 10.10 |
| 1120-28-1 |
| Methyl icosanoate |
| Arachidic acid methyl ester |
| Eicosanoic acid, methyl ester |
| METHYL EICOSANOATE |
| Methyl arachisate |
| C21H42O2 |
| MFCD00009014 |
| Eicosanoic acid-methyl ester |
| Eicosanoic Acid Methyl Ester |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.26% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.06% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.65% | 92.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.97% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.03% | 97.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.91% | 96.95% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 86.28% | 98.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.02% | 94.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.93% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.83% | 89.63% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.83% | 92.86% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.57% | 92.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.33% | 91.81% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.66% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.28% | 95.17% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.42% | 85.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 14259 |
| NPASS | NPC13483 |
| LOTUS | LTS0109160 |
| wikiData | Q63398929 |