Mansonone E
Internal ID | dc697d45-5b55-4764-8122-017744c39906 |
Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
IUPAC Name | 4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8-tetraene-10,11-dione |
SMILES (Canonical) | CC1COC2=C(C(=O)C(=O)C3=C(C=CC1=C32)C)C |
SMILES (Isomeric) | CC1COC2=C(C(=O)C(=O)C3=C(C=CC1=C32)C)C |
InChI | InChI=1S/C15H14O3/c1-7-4-5-10-8(2)6-18-15-9(3)13(16)14(17)11(7)12(10)15/h4-5,8H,6H2,1-3H3 |
InChI Key | SYWTYRLIJCHSLJ-UHFFFAOYSA-N |
Popularity | 14 references in papers |
Molecular Formula | C15H14O3 |
Molecular Weight | 242.27 g/mol |
Exact Mass | 242.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 2.30 |
5090-87-9 |
3,6,9-Trimethyl-2,3-dihydrobenzo[de]chromene-7,8-dione |
2,3-Dihydro-3,6,9-trimethylnaphtho[1,8-bc]pyran-7,8-dione |
Naphtho(1,8-bc)pyran-7,8-dione, 2,3-dihydro-3,6,9-trimethyl- |
Naphtho[1,8-bc]pyran-7,8-dione, 2,3-dihydro-3,6,9-trimethyl- |
CHEMBL362672 |
SCHEMBL7755715 |
DTXSID40965144 |
SYWTYRLIJCHSLJ-UHFFFAOYSA-N |
BDBM50493328 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1806 | P11388 | DNA topoisomerase II alpha |
18600 nM |
IC50 |
PMID: 23968711
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.41% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.06% | 98.95% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 90.62% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.80% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.07% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.89% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.39% | 100.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.07% | 94.80% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.88% | 93.18% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.84% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.83% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.19% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.50% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alangium chinense |
Helicteres angustifolia |
Hibiscus taiwanensis |
Thespesia garckeana |
Thespesia populnea |
Ulmus americana |
Ulmus davidiana |
Ulmus glabra |
Ulmus parvifolia |
Ulmus pumila |
PubChem | 94303 |
NPASS | NPC135730 |
ChEMBL | CHEMBL362672 |
LOTUS | LTS0263375 |
wikiData | Q82947317 |