Malvidin
Internal ID | 5281ba7d-ced4-4ab8-8f21-994b468e5eec |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3,5,7-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O |
InChI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)16(14)21)17-12(20)7-10-11(19)5-9(18)6-13(10)24-17/h3-7H,1-2H3,(H3-,18,19,20,21)/p+1 |
InChI Key | KZMACGJDUUWFCH-UHFFFAOYSA-O |
Popularity | 329 references in papers |
Molecular Formula | C17H15O7+ |
Molecular Weight | 331.30 g/mol |
Exact Mass | 331.08177781 g/mol |
Topological Polar Surface Area (TPSA) | 100.00 Ų |
XlogP | 0.00 |
10463-84-0 |
BRN 1691742 |
CHEBI:6674 |
3',5'-Dimethoxy-3,4',5,7-tetrahydroxyflavylium acid anion |
Benzopyrylium, 3 5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-, acid anion |
Flavylium, 3,4',5,7-tetrahydroxy-3',5'-dimethoxy-, acid anion |
Benzopyrylium, 3 5,7-trihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)- |
.malvidin |
SCHEMBL21739 |
CHEMBL255753 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of Malvidin 2D Structure of Malvidin](https://plantaedb.com/storage/docs/compounds/2023/07/malvidin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 |
17000 nM |
IC50 |
PMID: 21641214
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 95.71% | 92.68% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.25% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.17% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.56% | 94.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 91.33% | 96.12% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.26% | 92.94% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.25% | 99.15% |
CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 84.95% | 86.79% |
CHEMBL2581 | P07339 | Cathepsin D | 84.93% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.95% | 86.33% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 83.66% | 98.11% |
CHEMBL3194 | P02766 | Transthyretin | 83.62% | 90.71% |
CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 83.52% | 89.32% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.48% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.31% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.20% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.04% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.84% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 159287 |
NPASS | NPC127624 |
ChEMBL | CHEMBL255753 |
LOTUS | LTS0176844 |
wikiData | Q137220 |