Machiline
Internal ID | e876cb15-6382-4052-97d5-71626b08d30c |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
IUPAC Name | 1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol |
SMILES (Canonical) | COC1=C(C=C2C(NCCC2=C1)CC3=CC=C(C=C3)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(NCCC2=C1)CC3=CC=C(C=C3)O)O |
InChI | InChI=1S/C17H19NO3/c1-21-17-9-12-6-7-18-15(14(12)10-16(17)20)8-11-2-4-13(19)5-3-11/h2-5,9-10,15,18-20H,6-8H2,1H3 |
InChI Key | LVVKXRQZSRUVPY-UHFFFAOYSA-N |
Popularity | 17 references in papers |
Molecular Formula | C17H19NO3 |
Molecular Weight | 285.34 g/mol |
Exact Mass | 285.13649347 g/mol |
Topological Polar Surface Area (TPSA) | 61.70 Ų |
XlogP | 2.60 |
DL-Coclaurine |
(RS)-coclaurine |
(R,S)-Coclaurine |
CHEBI:18417 |
15548-30-8 |
1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol |
6-Methoxy-7-hydroxy-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline |
MLS000574945 |
CHEMBL453291 |
SCHEMBL1901279 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.74% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.55% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.45% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.60% | 93.99% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.94% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.78% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.41% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.19% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.68% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 88.66% | 98.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.12% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.90% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.60% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.39% | 96.95% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.96% | 85.00% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.31% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.12% | 92.62% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 81.94% | 99.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.97% | 90.93% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.32% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 281691 |
LOTUS | LTS0003620 |
wikiData | Q27103066 |