Leucanthoside
Internal ID | 4c313516-4df7-4ed0-a7c8-d9e8c4816844 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O)C4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O)C4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O11/c1-31-13-6-14-16(11(26)5-12(32-14)8-2-3-9(24)10(25)4-8)19(28)17(13)22-21(30)20(29)18(27)15(7-23)33-22/h2-6,15,18,20-25,27-30H,7H2,1H3 |
InChI Key | DLVLXOYLQKCAME-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.20 |
Leucanthoside |
6-Glucosyl-7-methoxy-5,3',4'-trihydroxyflavone |
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
Isoorientin 7-methyl ether |
FT-0775803 |
2-(3,4-Dihydroxyphenyl)-6-b-D-glucopyranosyl-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one, 9CI |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.74% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.23% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.04% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.55% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.85% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.51% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.34% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.06% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.90% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.69% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.46% | 96.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.37% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.68% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.59% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.21% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.03% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alliaria petiolata |
Cymbopogon citratus |
Iris lactea |
Leiothrix flavescens |
Phragmites australis |
Swertia pseudochinensis |
PubChem | 3556303 |
LOTUS | LTS0041479 |
wikiData | Q104984739 |