Gallocatechin gallate
Internal ID | 541f393b-26df-4b58-a8ad-b0e7b2ecf762 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins > Catechin gallates |
IUPAC Name | [(2R,3S)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
InChI | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m0/s1 |
InChI Key | WMBWREPUVVBILR-GHTZIAJQSA-N |
Popularity | 93 references in papers |
Molecular Formula | C22H18O11 |
Molecular Weight | 458.40 g/mol |
Exact Mass | 458.08491139 g/mol |
Topological Polar Surface Area (TPSA) | 197.00 Ų |
XlogP | 1.20 |
Atomic LogP (AlogP) | 2.23 |
H-Bond Acceptor | 11 |
H-Bond Donor | 8 |
Rotatable Bonds | 3 |
(+)-Gallocatechin gallate |
5127-64-0 |
(+)-Gallocatechol gallate |
(+)-Gallocatechin-3-o-gallate |
UNII-0C056HB16M |
gallocatechin-3-gallate |
Gallocatechin 3-O-gallate |
Gallic acid, ester with gallocatechol |
0C056HB16M |
Benzoic acid, 3,4,5-trihydroxy-, (2R,3S)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8422 | 84.22% |
Caco-2 | - | 0.9372 | 93.72% |
Blood Brain Barrier | - | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.7000 | 70.00% |
Subcellular localzation | Mitochondria | 0.6166 | 61.66% |
OATP2B1 inhibitior | + | 0.7036 | 70.36% |
OATP1B1 inhibitior | - | 0.4147 | 41.47% |
OATP1B3 inhibitior | - | 0.5697 | 56.97% |
MATE1 inhibitior | - | 0.7400 | 74.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | - | 0.4915 | 49.15% |
P-glycoprotein inhibitior | - | 0.5518 | 55.18% |
P-glycoprotein substrate | - | 0.8848 | 88.48% |
CYP3A4 substrate | + | 0.5673 | 56.73% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7217 | 72.17% |
CYP3A4 inhibition | - | 0.7662 | 76.62% |
CYP2C9 inhibition | - | 0.8369 | 83.69% |
CYP2C19 inhibition | - | 0.8089 | 80.89% |
CYP2D6 inhibition | - | 0.9553 | 95.53% |
CYP1A2 inhibition | - | 0.8058 | 80.58% |
CYP2C8 inhibition | + | 0.6551 | 65.51% |
CYP inhibitory promiscuity | - | 0.8067 | 80.67% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.6339 | 63.39% |
Eye corrosion | - | 0.9906 | 99.06% |
Eye irritation | + | 0.5642 | 56.42% |
Skin irritation | - | 0.6348 | 63.48% |
Skin corrosion | - | 0.9587 | 95.87% |
Ames mutagenesis | - | 0.6000 | 60.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8916 | 89.16% |
Micronuclear | + | 0.8859 | 88.59% |
Hepatotoxicity | + | 0.9125 | 91.25% |
skin sensitisation | - | 0.8369 | 83.69% |
Respiratory toxicity | + | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.8444 | 84.44% |
Mitochondrial toxicity | + | 0.6625 | 66.25% |
Nephrotoxicity | - | 0.6893 | 68.93% |
Acute Oral Toxicity (c) | IV | 0.3764 | 37.64% |
Estrogen receptor binding | + | 0.7801 | 78.01% |
Androgen receptor binding | + | 0.8696 | 86.96% |
Thyroid receptor binding | + | 0.5973 | 59.73% |
Glucocorticoid receptor binding | + | 0.6468 | 64.68% |
Aromatase binding | - | 0.8515 | 85.15% |
PPAR gamma | + | 0.6545 | 65.45% |
Honey bee toxicity | - | 0.8534 | 85.34% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5550 | 55.50% |
Fish aquatic toxicity | + | 0.9197 | 91.97% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3596077 | Q11130 | Alpha-(1,3)-fucosyltransferase 7 |
700 nM |
IC50 |
via Super-PRED
|
CHEMBL4860 | P10415 | Apoptosis regulator Bcl-2 |
235 nM 335 nM |
Ki Ki |
via Super-PRED
via Super-PRED |
CHEMBL4822 | P56817 | Beta-secretase 1 |
1800 nM 757 nM |
IC50 IC50 |
PMID: 14592472
via Super-PRED |
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 |
500 nM |
IC50 |
via Super-PRED
|
CHEMBL2392 | P06746 | DNA polymerase beta |
446.7 nM |
Potency |
via Super-PRED
|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
277 nM |
IC50 |
via Super-PRED
|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
89.1 nM |
Potency |
via Super-PRED
|
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A |
330 nM |
IC50 |
via Super-PRED
|
CHEMBL4302 | P08183 | P-glycoprotein 1 |
122.6 nM |
IC50 |
via Super-PRED
|
CHEMBL3334418 | P18669 | Phosphoglycerate mutase 1 |
490 nM |
IC50 |
via Super-PRED
|
CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 |
187 nM 86 nM |
IC50 IC50 |
via Super-PRED
via Super-PRED |
CHEMBL6101 | P42224 | Signal transducer and activator of transcription 1-alpha/beta |
700 nM |
Kd |
via Super-PRED
|
CHEMBL3194 | P02766 | Transthyretin |
400 nM |
Kd |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
223.9 nM 316.2 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.85% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.05% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.21% | 86.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.01% | 83.00% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 88.84% | 96.37% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.11% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.34% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.68% | 99.17% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 85.77% | 97.53% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.70% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.10% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 83.41% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.50% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.74% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.24% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ampelopsis japonica |
Camellia sinensis |
Cistus × incanus |
Morus alba |
Pistacia vera |
Senegalia catechu |
Solanum nigrum |
Vitis vinifera |
PubChem | 5276890 |
NPASS | NPC104983 |
ChEMBL | CHEMBL126079 |
LOTUS | LTS0223197 |
wikiData | Q5519120 |