Isomaculosidine
| Internal ID | 9adb334f-fb58-4ba5-84bc-c822abc73090 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 6,8-dimethoxy-9-methylfuro[2,3-b]quinolin-4-one |
| SMILES (Canonical) | CN1C2=C(C=C(C=C2OC)OC)C(=O)C3=C1OC=C3 |
| SMILES (Isomeric) | CN1C2=C(C=C(C=C2OC)OC)C(=O)C3=C1OC=C3 |
| InChI | InChI=1S/C14H13NO4/c1-15-12-10(6-8(17-2)7-11(12)18-3)13(16)9-4-5-19-14(9)15/h4-7H,1-3H3 |
| InChI Key | FXHBKLQQNAGNJN-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 51.90 Ų |
| XlogP | 2.50 |
| 518-96-7 |
| 6,8-dimethoxy-9-methylfuro[2,3-b]quinolin-4-one |
| Furo(2,3-b)quinolin-4(9H)-one, 6,8-dimethoxy-9-methyl- |
| orb1689986 |
| SCHEMBL29642595 |
| DTXSID00199741 |
| HY-N3473 |
| MSK197457 |
| AKOS032949112 |
| DA-74567 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.29% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.75% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.56% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.33% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.85% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.52% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.65% | 96.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.68% | 93.65% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.17% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.06% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.62% | 90.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.45% | 94.42% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.39% | 86.33% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.20% | 90.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.95% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.85% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.29% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.63% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ageratina saltillensis |
| Dictamnus albus |
| Dictamnus dasycarpus |
| Esenbeckia hartmanii |
| Grewia villosa |
| Salta triflora |
| Salvia polystachya |
| Trifolium montanum |
| PubChem | 3083609 |
| NPASS | NPC136545 |
| LOTUS | LTS0194824 |
| wikiData | Q83072684 |