Emmolic acid
Internal ID | fe5c8983-bd8a-4386-8415-58d848a54877 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 16-hydroxy-1,2,14,17,17-pentamethyl-8-prop-1-en-2-ylpentacyclo[11.7.0.02,10.05,9.014,18]icosane-5,15-dicarboxylic acid |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C(C3(CC2)C)(CCC5C4(C(C(C5(C)C)O)C(=O)O)C)C)C(=O)O |
SMILES (Isomeric) | CC(=C)C1CCC2(C1C3CCC4C(C3(CC2)C)(CCC5C4(C(C(C5(C)C)O)C(=O)O)C)C)C(=O)O |
InChI | InChI=1S/C30H46O5/c1-16(2)17-10-13-30(25(34)35)15-14-27(5)18(21(17)30)8-9-20-28(27,6)12-11-19-26(3,4)23(31)22(24(32)33)29(19,20)7/h17-23,31H,1,8-15H2,2-7H3,(H,32,33)(H,34,35) |
InChI Key | WLCHQSHZHFLMJH-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H46O5 |
Molecular Weight | 486.70 g/mol |
Exact Mass | 486.33452456 g/mol |
Topological Polar Surface Area (TPSA) | 94.80 Ų |
XlogP | 7.60 |
WLCHQSHZHFLMJH-UHFFFAOYSA-N |
AKOS032948647 |
1(2->3)-Abeo-3-hydroxy-20(29)-lupene-2,28-dioic acid |
A(1)-Norlup-20(29)-en-28-oic acid, 2.alpha.-carboxy-3.beta.-hydroxy- |
A(1)-Norlup-20(30)-en-28-oic acid, 2.alpha.-carboxy-3.beta.-hydroxy- |
A(1),23-Dinorlup-20(29)-en-28-oic acid, 2.alpha.-carboxy-3.beta.-hydroxy- |
A(1)-Norlup-20(29)-en-28-oic acid, 2-carboxy-3-hydroxy-, (2.alpha.,3.beta.)- |
2-Hydroxy-10-isopropenyl-3,3,5a,5b,12b-pentamethyloctadecahydrodicyclopenta[a,i]phenanthrene-1,7a(1H)-dicarboxylic acid # |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.25% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.27% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.92% | 91.19% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.66% | 92.94% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.70% | 96.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.28% | 96.38% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.37% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.11% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.91% | 97.25% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.51% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.16% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.69% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 578549 |
LOTUS | LTS0224908 |
wikiData | Q105307869 |