(3,6a,10',11',12',15',16',17',31',32',36',37'-dodecahydroxy-2',5,7',20',28',41'-hexaoxospiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,39'-3,6,21,24,27,38,42-heptaoxanonacyclo[35.2.2.133,36.01,35.04,23.05,26.08,13.014,19.029,34]dotetraconta-8,10,12,14,16,18,29,31,33-nonaene]-25'-yl) 3,4,5-trihydroxybenzoate
Internal ID | 553cf49b-c66c-4aa7-b955-d98fd203044c |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (3,6a,10',11',12',15',16',17',31',32',36',37'-dodecahydroxy-2',5,7',20',28',41'-hexaoxospiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,39'-3,6,21,24,27,38,42-heptaoxanonacyclo[35.2.2.133,36.01,35.04,23.05,26.08,13.014,19.029,34]dotetraconta-8,10,12,14,16,18,29,31,33-nonaene]-25'-yl) 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C2C(O1)(C3(C(=O)O2)C45CC(=O)C(O3)(C6(C4C7=C(O6)C(=C(C=C7C(=O)OC8C9C(C(COC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C=C1C(=O)O9)O)O)O)O)O)O)OC8OC(=O)C1=CC(=C(C(=C1)O)O)O)OC5=O)O)O)O)O)O)O |
SMILES (Isomeric) | C1C(C2C(O1)(C3(C(=O)O2)C45CC(=O)C(O3)(C6(C4C7=C(O6)C(=C(C=C7C(=O)OC8C9C(C(COC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C=C1C(=O)O9)O)O)O)O)O)O)OC8OC(=O)C1=CC(=C(C(=C1)O)O)O)OC5=O)O)O)O)O)O)O |
InChI | InChI=1S/C47H34O32/c48-13-1-9(2-14(49)24(13)55)36(61)77-40-33-32-30(19(72-40)8-70-37(62)10-3-15(50)25(56)28(59)21(10)22-11(38(63)73-32)4-16(51)26(57)29(22)60)75-41(65)43-6-20(54)45(67,79-44(43)42(66)76-35-18(53)7-71-47(35,44)69)46(68)34(43)23-12(39(64)74-33)5-17(52)27(58)31(23)78-46/h1-5,18-19,30,32-35,40,48-53,55-60,67-69H,6-8H2 |
InChI Key | XCXWMHRRISFUFF-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C47H34O32 |
Molecular Weight | 1110.80 g/mol |
Exact Mass | 1110.1033189 g/mol |
Topological Polar Surface Area (TPSA) | 515.00 Ų |
XlogP | -2.80 |
There are no found synonyms. |
![2D Structure of (3,6a,10',11',12',15',16',17',31',32',36',37'-dodecahydroxy-2',5,7',20',28',41'-hexaoxospiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,39'-3,6,21,24,27,38,42-heptaoxanonacyclo[35.2.2.133,36.01,35.04,23.05,26.08,13.014,19.029,34]dotetraconta-8,10,12,14,16,18,29,31,33-nonaene]-25'-yl) 3,4,5-trihydroxybenzoate 2D Structure of (3,6a,10',11',12',15',16',17',31',32',36',37'-dodecahydroxy-2',5,7',20',28',41'-hexaoxospiro[3,3a-dihydro-2H-furo[3,2-b]furan-6,39'-3,6,21,24,27,38,42-heptaoxanonacyclo[35.2.2.133,36.01,35.04,23.05,26.08,13.014,19.029,34]dotetraconta-8,10,12,14,16,18,29,31,33-nonaene]-25'-yl) 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/edc57270-8600-11ee-9449-79d91b585fd1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.39% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.84% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.37% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.92% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.54% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 91.77% | 98.95% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 90.73% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.30% | 99.23% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.22% | 97.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.88% | 91.19% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.80% | 96.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.44% | 92.94% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.49% | 96.95% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 86.52% | 97.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.98% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.07% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.81% | 99.15% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.61% | 93.03% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.04% | 94.42% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.95% | 97.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.83% | 91.71% |
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 81.51% | 95.44% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.10% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carpinus laxiflora |
Cercidiphyllum japonicum |
Elaeocarpus sylvestris |
Euphorbia helioscopia |
Euphorbia watanabei |
Excoecaria kawakamii |
Geranium thunbergii |
Mallotus japonicus |
Phyllanthus amarus |
PubChem | 3459965 |
LOTUS | LTS0222182 |
wikiData | Q100146249 |