Dimethyltryptamine
Internal ID | 175cdd86-80af-41f2-b894-d8198d39252c |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Tryptamines and derivatives |
IUPAC Name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine |
SMILES (Canonical) | CN(C)CCC1=CNC2=CC=CC=C21 |
SMILES (Isomeric) | CN(C)CCC1=CNC2=CC=CC=C21 |
InChI | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
InChI Key | DMULVCHRPCFFGV-UHFFFAOYSA-N |
Popularity | 1,319 references in papers |
Molecular Formula | C12H16N2 |
Molecular Weight | 188.27 g/mol |
Exact Mass | 188.131348519 g/mol |
Topological Polar Surface Area (TPSA) | 19.00 Ų |
XlogP | 2.50 |
DIMETHYLTRYPTAMINE |
61-50-7 |
2-(3-Indolyl)ethyldimethylamine |
3-(2-Dimethylaminoethyl)indole |
1H-Indole-3-ethanamine, N,N-dimethyl- |
2-(1H-Indol-3-yl)-N,N-dimethylethanamine |
N,N-Dimethyl-1H-indole-3-ethylamine |
DMT (psychogenic) |
DMT |
N,N-dimethyl-1H-Indole-3-ethanamine |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL214 | P08908 | Serotonin 1a (5-HT1a) receptor |
410 nM |
Ki |
DOI: 10.1021/np960678l
|
CHEMBL224 | P28223 | Serotonin 2a (5-HT2a) receptor |
65 nM |
Ki |
PMID: 10090793
|
CHEMBL1833 | P41595 | Serotonin 2b (5-HT2b) receptor |
101 nM |
Ki |
PMID: 10090793
|
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor |
33 nM |
Ki |
PMID: 10090793
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.92% | 91.11% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 96.49% | 90.71% |
CHEMBL240 | Q12809 | HERG | 95.62% | 89.76% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.14% | 93.99% |
CHEMBL2581 | P07339 | Cathepsin D | 94.89% | 98.95% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 94.08% | 88.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.68% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.81% | 95.56% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.07% | 90.08% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 90.87% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.62% | 94.75% |
CHEMBL228 | P31645 | Serotonin transporter | 85.37% | 95.51% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.85% | 98.59% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.51% | 97.79% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.92% | 94.73% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.79% | 87.45% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.93% | 96.67% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.83% | 85.49% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.34% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6089 |
NPASS | NPC73767 |
ChEMBL | CHEMBL12420 |
LOTUS | LTS0223878 |
wikiData | Q407217 |