Curine
Internal ID | d447d9f8-641a-4b1d-8d62-621e31f43123 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Diarylethers |
IUPAC Name | (1R,16R)-10,25-dimethoxy-15,30-dimethyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaene-9,21-diol |
SMILES (Canonical) | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C3C=C2[C@H]1CC4=CC=C(C=C4)OC5=C6[C@@H](CC7=CC(=C(C=C7)O)O3)N(CCC6=CC(=C5O)OC)C)OC |
InChI | InChI=1S/C36H38N2O6/c1-37-13-11-23-18-31(41-3)32-20-26(23)27(37)15-21-5-8-25(9-6-21)43-36-34-24(19-33(42-4)35(36)40)12-14-38(2)28(34)16-22-7-10-29(39)30(17-22)44-32/h5-10,17-20,27-28,39-40H,11-16H2,1-4H3/t27-,28-/m1/s1 |
InChI Key | NGZXDRGWBULKFA-VSGBNLITSA-N |
Popularity | 24 references in papers |
Molecular Formula | C36H38N2O6 |
Molecular Weight | 594.70 g/mol |
Exact Mass | 594.27298694 g/mol |
Topological Polar Surface Area (TPSA) | 83.90 Ų |
XlogP | 6.00 |
Atomic LogP (AlogP) | 6.56 |
H-Bond Acceptor | 8 |
H-Bond Donor | 2 |
Rotatable Bonds | 2 |
(-)-Bebeerine |
436-05-5 |
(-)-Curine |
l-Curine |
L-Bebeerine |
1-Bebeerine |
1-Curine |
CHONODOENDRINE (L) |
Aristolochine (C36 alkaloid) |
MLS000069827 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7591 | 75.91% |
Caco-2 | - | 0.5517 | 55.17% |
Blood Brain Barrier | + | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.4941 | 49.41% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9363 | 93.63% |
OATP1B3 inhibitior | + | 0.9469 | 94.69% |
MATE1 inhibitior | - | 0.7200 | 72.00% |
OCT2 inhibitior | - | 0.6500 | 65.00% |
BSEP inhibitior | + | 0.9835 | 98.35% |
P-glycoprotein inhibitior | + | 0.9190 | 91.90% |
P-glycoprotein substrate | + | 0.6330 | 63.30% |
CYP3A4 substrate | + | 0.6817 | 68.17% |
CYP2C9 substrate | + | 0.7890 | 78.90% |
CYP2D6 substrate | + | 0.7253 | 72.53% |
CYP3A4 inhibition | - | 0.8855 | 88.55% |
CYP2C9 inhibition | - | 0.9436 | 94.36% |
CYP2C19 inhibition | - | 0.9026 | 90.26% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | + | 0.5844 | 58.44% |
CYP inhibitory promiscuity | - | 0.9625 | 96.25% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6291 | 62.91% |
Eye corrosion | - | 0.9893 | 98.93% |
Eye irritation | - | 0.9460 | 94.60% |
Skin irritation | - | 0.7873 | 78.73% |
Skin corrosion | - | 0.9527 | 95.27% |
Ames mutagenesis | + | 0.7500 | 75.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.9321 | 93.21% |
Micronuclear | + | 0.6100 | 61.00% |
Hepatotoxicity | - | 0.9875 | 98.75% |
skin sensitisation | - | 0.8884 | 88.84% |
Respiratory toxicity | + | 0.8667 | 86.67% |
Reproductive toxicity | + | 0.8111 | 81.11% |
Mitochondrial toxicity | + | 0.6750 | 67.50% |
Nephrotoxicity | - | 0.8727 | 87.27% |
Acute Oral Toxicity (c) | III | 0.7270 | 72.70% |
Estrogen receptor binding | + | 0.6709 | 67.09% |
Androgen receptor binding | + | 0.7309 | 73.09% |
Thyroid receptor binding | + | 0.6033 | 60.33% |
Glucocorticoid receptor binding | + | 0.8511 | 85.11% |
Aromatase binding | + | 0.6714 | 67.14% |
PPAR gamma | - | 0.4927 | 49.27% |
Honey bee toxicity | - | 0.7485 | 74.85% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | + | 0.8050 | 80.50% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL236 | P41143 | Delta opioid receptor |
44174 nM |
EC50 |
via CMAUP
|
CHEMBL2362978 | P43351 | DNA repair protein RAD52 homolog |
35210 nM |
AC50 |
via CMAUP
|
CHEMBL5514 | P42858 | Huntingtin |
1000 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
14125.4 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.35% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.85% | 91.11% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.95% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.54% | 91.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.09% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.06% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.68% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.60% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.53% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.09% | 93.40% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.24% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.89% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.67% | 89.62% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.45% | 82.38% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.27% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.94% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.83% | 91.49% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.53% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 83.15% | 98.75% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.13% | 91.03% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.01% | 91.79% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.83% | 100.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.42% | 89.50% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.12% | 90.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.03% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.86% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.73% | 92.62% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.20% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buxus sempervirens |
Chondrodendron tomentosum |
Cissampelos pareira |
Curarea toxicofera |
Cyclea barbata |
Cyclea tonkinensis |
Isolona ghesquierei |
Sinomenium acutum |
Stephania tetrandra |
PubChem | 253793 |
NPASS | NPC290005 |
ChEMBL | CHEMBL1169627 |
LOTUS | LTS0156353 |
wikiData | Q27263150 |