[2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate
Internal ID | dd99a7f3-4385-4590-bef1-29ff76cf0531 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 1-hydroxy-6-oxocyclohex-2-ene-1-carboxylate |
SMILES (Canonical) | C1CC(=O)C(C=C1)(C(=O)OCC2=CC=CC=C2OC3C(C(C(C(O3)CO)O)O)O)O |
SMILES (Isomeric) | C1CC(=O)C(C=C1)(C(=O)OCC2=CC=CC=C2O[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)O)O |
InChI | InChI=1S/C20H24O10/c21-9-13-15(23)16(24)17(25)18(30-13)29-12-6-2-1-5-11(12)10-28-19(26)20(27)8-4-3-7-14(20)22/h1-2,4-6,8,13,15-18,21,23-25,27H,3,7,9-10H2/t13-,15-,16+,17-,18-,20?/m0/s1 |
InChI Key | CZDNLUMNELLDDD-SZDXVUTASA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O10 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | -0.60 |
29836-41-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.28% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.21% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.06% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.36% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.28% | 85.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 88.27% | 95.83% |
CHEMBL2581 | P07339 | Cathepsin D | 86.76% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.98% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.24% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.02% | 99.23% |
CHEMBL220 | P22303 | Acetylcholinesterase | 83.40% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.97% | 96.61% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.83% | 95.93% |
CHEMBL3891 | P07384 | Calpain 1 | 81.81% | 93.04% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.30% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Populus balsamifera |
Populus deltoides |
Populus tremula |
Populus tremuloides |
Salix caprea |
Salix hastata |
Salix interior |
Salix myrsinifolia |
Salix purpurea |
Salix sericea |
Salix viminalis |
PubChem | 133554354 |
LOTUS | LTS0158233 |
wikiData | Q105103441 |