[2-[[(4aR)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,4-dihydroxy-6-(3-hydroxyphenyl)benzoate
Internal ID | d97e942e-afbb-40b7-991c-8b33a023e147 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
IUPAC Name | [2-[[(4aR)-4-ethenyl-8-oxo-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-3-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] 2,4-dihydroxy-6-(3-hydroxyphenyl)benzoate |
SMILES (Canonical) | C=CC1C2CCOC(=O)C2=COC1OC3C(C(C(C(O3)CO)O)O)OC(=O)C4=C(C=C(C=C4O)O)C5=CC(=CC=C5)O |
SMILES (Isomeric) | C=CC1[C@H]2CCOC(=O)C2=COC1OC3C(C(C(C(O3)CO)O)O)OC(=O)C4=C(C=C(C=C4O)O)C5=CC(=CC=C5)O |
InChI | InChI=1S/C29H30O13/c1-2-16-17-6-7-38-26(36)19(17)12-39-28(16)42-29-25(24(35)23(34)21(11-30)40-29)41-27(37)22-18(9-15(32)10-20(22)33)13-4-3-5-14(31)8-13/h2-5,8-10,12,16-17,21,23-25,28-35H,1,6-7,11H2/t16?,17-,21?,23?,24?,25?,28?,29?/m1/s1 |
InChI Key | DBOVHQOUSDWAPQ-BXMITHPTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H30O13 |
Molecular Weight | 586.50 g/mol |
Exact Mass | 586.16864101 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.38% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.56% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.26% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.39% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.16% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.96% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.70% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.56% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.54% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.85% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.52% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.38% | 91.24% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.64% | 91.19% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 83.59% | 96.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.58% | 94.45% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.49% | 95.83% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.97% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.55% | 95.89% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.51% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.17% | 91.49% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 80.87% | 97.53% |
CHEMBL3194 | P02766 | Transthyretin | 80.64% | 90.71% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.29% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gentiana cruciata |
Gentiana lutea |
Gentiana purpurea |
Gentianella nitida |
Swertia chirata |
Swertia chirayta |
Swertia japonica |
Swertia mussotii |
PubChem | 137795174 |
LOTUS | LTS0119732 |
wikiData | Q104253049 |