Arvenin I
Internal ID | 1c237b68-f967-4e78-9de9-154e8d441aaa |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | [(E,6R)-6-hydroxy-6-[(2S,8S,9R,10R,13R,14S,16R,17R)-16-hydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-5-oxohept-3-en-2-yl] acetate |
SMILES (Canonical) | CC(=O)OC(C)(C)C=CC(=O)C(C)(C1C(CC2(C1(CC(=O)C3(C2CC=C4C3CC(C(=O)C4(C)C)OC5C(C(C(C(O5)CO)O)O)O)C)C)C)O)O |
SMILES (Isomeric) | CC(=O)OC(C)(C)/C=C/C(=O)[C@@](C)([C@H]1[C@@H](C[C@@]2([C@@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3C[C@@H](C(=O)C4(C)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C)O)O |
InChI | InChI=1S/C38H56O13/c1-18(40)51-33(2,3)13-12-25(42)38(9,48)30-21(41)15-35(6)24-11-10-19-20(37(24,8)26(43)16-36(30,35)7)14-22(31(47)34(19,4)5)49-32-29(46)28(45)27(44)23(17-39)50-32/h10,12-13,20-24,27-30,32,39,41,44-46,48H,11,14-17H2,1-9H3/b13-12+/t20-,21-,22+,23-,24+,27-,28+,29-,30+,32-,35+,36-,37+,38+/m1/s1 |
InChI Key | PQOVWWZVVIGRPP-BBANTJNRSA-N |
Popularity | 3 references in papers |
Molecular Formula | C38H56O13 |
Molecular Weight | 720.80 g/mol |
Exact Mass | 720.37209184 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | 1.00 |
65247-27-0 |
Cucurbitacin B 2-O-beta-D-glucoside |
[(E,6R)-6-hydroxy-6-[(2S,8S,9R,10R,13R,14S,16R,17R)-16-hydroxy-4,4,9,13,14-pentamethyl-3,11-dioxo-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-5-oxohept-3-en-2-yl] acetate |
CHEMBL540114 |
HY-N6579 |
AKOS040760354 |
FS-7536 |
CS-0034275 |
19-Norlanosta-5,23-diene-3,11,22-trione, 25-(acetyloxy)-2-(beta-D-glucophranosyloxy)-16,20-dihydroxy-9-methyl-, (2beta, 9beta, 10apha, 16alpha,23E)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.34% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.12% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.04% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.00% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.60% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.02% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.69% | 96.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.49% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.01% | 86.33% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 88.17% | 87.67% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.70% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.61% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.23% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.89% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.84% | 95.89% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.09% | 89.34% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.93% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Begonia heracleifolia |
Bryonia cretica |
Cayaponia angustiloba |
Citrullus colocynthis |
Cucumis melo |
Helicteres angustifolia |
Iberis umbellata |
Luffa operculata |
Nernstia mexicana |
PubChem | 6441104 |
LOTUS | LTS0082665 |
wikiData | Q104393313 |