Anisofolin A
Internal ID | 51f342ee-61ab-4fe4-9a8f-ef36c4d56d6a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)O)OC(=O)C=CC6=CC=C(C=C6)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)O)OC(=O)/C=C/C6=CC=C(C=C6)O)O)O |
InChI | InChI=1S/C39H32O14/c40-24-9-1-21(2-10-24)5-15-33(45)49-20-32-36(47)38(53-34(46)16-6-22-3-11-25(41)12-4-22)37(48)39(52-32)50-27-17-28(43)35-29(44)19-30(51-31(35)18-27)23-7-13-26(42)14-8-23/h1-19,32,36-43,47-48H,20H2/b15-5+,16-6+/t32-,36-,37-,38+,39-/m1/s1 |
InChI Key | LHMKSPOTCLVAKR-AVMIHGAISA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H32O14 |
Molecular Weight | 724.70 g/mol |
Exact Mass | 724.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 4.90 |
83529-71-9 |
[(2R,3R,4S,5R,6S)-3,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
AKOS040761358 |
FS-9081 |
4H-1-Benzopyran-4-one, 7-[[3,6-bis-O-[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]--D-glucopyranosyl]oxy]-5-hydroxy-2-(4-hydroxyphenyl)-, (E,E)4H-1-enzopyran-4-ne, 7-[3,6-is--(2E)-3-(4-ydroxyphenyl)-1-xo-2-ropen-1-l]---lucopyranosyl]xy]-5-ydroxy-2-(4-ydroxyphenyl)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.54% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.81% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.89% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 97.38% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.74% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 92.11% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.52% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.46% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.04% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.34% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.26% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.18% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.73% | 95.78% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.49% | 97.28% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.91% | 91.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 86.76% | 98.35% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.46% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.08% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.79% | 96.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.66% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.09% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.99% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.91% | 85.14% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.55% | 83.57% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 80.01% | 97.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anisomeles indica |
Leucas cephalotes |
Marrubium velutinum |
Stachys byzantina |
PubChem | 21721971 |
LOTUS | LTS0220090 |
wikiData | Q105151849 |