Angolensic acid methyl ester
Internal ID | cd0c51df-b14e-4843-95fa-6a29aca0feed |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | methyl 2-[13-(furan-3-yl)-6,6,8,12-tetramethyl-17-methylidene-5,15-dioxo-2,14-dioxatetracyclo[7.7.1.01,12.03,8]heptadecan-7-yl]acetate |
SMILES (Canonical) | CC1(C(C2(C3CCC4(C(OC(=O)CC4(C3=C)OC2CC1=O)C5=COC=C5)C)C)CC(=O)OC)C |
SMILES (Isomeric) | CC1(C(C2(C3CCC4(C(OC(=O)CC4(C3=C)OC2CC1=O)C5=COC=C5)C)C)CC(=O)OC)C |
InChI | InChI=1S/C27H34O7/c1-15-17-7-9-25(4)23(16-8-10-32-14-16)33-22(30)13-27(15,25)34-20-12-19(28)24(2,3)18(26(17,20)5)11-21(29)31-6/h8,10,14,17-18,20,23H,1,7,9,11-13H2,2-6H3 |
InChI Key | YNMYHRYTRCKSMI-UHFFFAOYSA-N |
Popularity | 12 references in papers |
Molecular Formula | C27H34O7 |
Molecular Weight | 470.60 g/mol |
Exact Mass | 470.23045342 g/mol |
Topological Polar Surface Area (TPSA) | 92.00 Ų |
XlogP | 2.70 |
METHYL ANGOLENSATE |
2629-14-3 |
NSC 117177 |
Methyl (1alpha,5beta,13alpha,14beta,17aalpha)-1,14:21,23-diepoxy-4,4-dimethyl-3,16-dioxo-D-homo-24-nor-17-oxa-6,7-secachola-7,20,22-triene-6-carboxylate |
ANGOLENSIC ACID, METHYL ESTER |
D-Homo-24-nor-17-oxa-6,7-secachola-7,20,22-triene-6-carboxylic acid, 1,14:21,23-diepoxy-4,4-dimethyl-3,16-dioxo-, methyl ester, (1alpha,5beta,13alpha,14beta,17aalpha)- |
NSC117177 |
DTXSID90949151 |
NSC-117177 |
Methyl [4-(furan-3-yl)-4a,7a,9,9-tetramethyl-13-methylidene-2,10-dioxododecahydro-4H-7,12a-methanopyrano[4,3-b][1]benzoxocin-8-yl]acetate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.75% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.04% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.00% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.05% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.02% | 90.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.66% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.79% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.63% | 99.23% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.06% | 93.04% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.46% | 100.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.19% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.18% | 95.89% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.65% | 92.88% |
CHEMBL2581 | P07339 | Cathepsin D | 80.58% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 80.05% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 419676 |
LOTUS | LTS0200686 |
wikiData | Q82927001 |