9H-Pyrido[3,4-B]indole
Internal ID | ea655620-e960-4f7b-98f5-5a34ed3b0d16 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
IUPAC Name | 9H-pyrido[3,4-b]indole |
SMILES (Canonical) | C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 |
SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C(N2)C=NC=C3 |
InChI | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
InChI Key | AIFRHYZBTHREPW-UHFFFAOYSA-N |
Popularity | 2,525 references in papers |
Molecular Formula | C11H8N2 |
Molecular Weight | 168.19 g/mol |
Exact Mass | 168.068748264 g/mol |
Topological Polar Surface Area (TPSA) | 28.70 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 2.72 |
H-Bond Acceptor | 1 |
H-Bond Donor | 1 |
Rotatable Bonds | 0 |
Norharman |
Norharmane |
244-63-3 |
beta-Carboline |
2,9-Diazafluorene |
Carbazoline |
9H-Beta-carboline |
2-Azacarbazole |
2H-Pyrido[3,4-b]indole |
.beta.-Carboline |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 9H-Pyrido[3,4-B]indole 2D Structure of 9H-Pyrido[3,4-B]indole](https://plantaedb.com/storage/docs/compounds/2023/07/9h-pyrido34-bindole.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.5989 | 59.89% |
Blood Brain Barrier | + | 0.9500 | 95.00% |
Human oral bioavailability | + | 0.5143 | 51.43% |
Subcellular localzation | Mitochondria | 0.6100 | 61.00% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9414 | 94.14% |
OATP1B3 inhibitior | + | 0.9596 | 95.96% |
MATE1 inhibitior | - | 0.8800 | 88.00% |
OCT2 inhibitior | - | 0.7500 | 75.00% |
BSEP inhibitior | - | 0.6654 | 66.54% |
P-glycoprotein inhibitior | - | 0.9768 | 97.68% |
P-glycoprotein substrate | - | 0.9412 | 94.12% |
CYP3A4 substrate | - | 0.6883 | 68.83% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7180 | 71.80% |
CYP3A4 inhibition | + | 0.5200 | 52.00% |
CYP2C9 inhibition | - | 0.7490 | 74.90% |
CYP2C19 inhibition | - | 0.6934 | 69.34% |
CYP2D6 inhibition | + | 0.7247 | 72.47% |
CYP1A2 inhibition | + | 0.9162 | 91.62% |
CYP2C8 inhibition | + | 0.7493 | 74.93% |
CYP inhibitory promiscuity | + | 0.6519 | 65.19% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9400 | 94.00% |
Carcinogenicity (trinary) | Non-required | 0.7005 | 70.05% |
Eye corrosion | - | 0.9445 | 94.45% |
Eye irritation | + | 0.9883 | 98.83% |
Skin irritation | + | 0.6713 | 67.13% |
Skin corrosion | - | 0.9208 | 92.08% |
Ames mutagenesis | + | 0.7900 | 79.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6579 | 65.79% |
Micronuclear | + | 0.7900 | 79.00% |
Hepatotoxicity | + | 0.7146 | 71.46% |
skin sensitisation | - | 0.8362 | 83.62% |
Respiratory toxicity | + | 0.6333 | 63.33% |
Reproductive toxicity | + | 0.7556 | 75.56% |
Mitochondrial toxicity | - | 0.7750 | 77.50% |
Nephrotoxicity | - | 0.6840 | 68.40% |
Acute Oral Toxicity (c) | III | 0.6768 | 67.68% |
Estrogen receptor binding | + | 0.7226 | 72.26% |
Androgen receptor binding | - | 0.4921 | 49.21% |
Thyroid receptor binding | + | 0.6004 | 60.04% |
Glucocorticoid receptor binding | - | 0.5444 | 54.44% |
Aromatase binding | + | 0.6795 | 67.95% |
PPAR gamma | - | 0.5401 | 54.01% |
Honey bee toxicity | - | 0.9065 | 90.65% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.7500 | 75.00% |
Fish aquatic toxicity | - | 0.5329 | 53.29% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
35481.3 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase |
90000 nM |
IC50 |
PMID: 22112538
|
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit |
7943.28 nM |
Ki |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1951 | P21397 | Monoamine oxidase A |
260 nM |
Ki |
via Super-PRED
|
CHEMBL2039 | P27338 | Monoamine oxidase B |
1200 nM |
Ki |
PMID: 22071524
|
CHEMBL4722 | O14965 | Serine/threonine-protein kinase Aurora-A |
15848.93 nM |
Ki |
via CMAUP
|
CHEMBL2147 | P11309 | Serine/threonine-protein kinase PIM1 |
6309.57 nM |
Ki |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
1412.5 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 96.26% | 94.62% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 95.28% | 98.59% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.83% | 94.45% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 90.90% | 93.24% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.34% | 91.11% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.70% | 85.30% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.19% | 96.00% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.17% | 88.56% |
CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 86.80% | 99.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.26% | 94.08% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.35% | 96.47% |
CHEMBL2535 | P11166 | Glucose transporter | 84.56% | 98.75% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 84.55% | 91.73% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 83.92% | 97.00% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 82.31% | 98.21% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.18% | 80.96% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.33% | 96.09% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.30% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 64961 |
NPASS | NPC63545 |
ChEMBL | CHEMBL275224 |
LOTUS | LTS0263207 |
wikiData | Q414226 |