5-O-Feruloylquinic acid
Internal ID | de9fd328-63b6-4c84-a7ef-81b1fe5b4026 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Cyclitols and derivatives > Quinic acids and derivatives |
IUPAC Name | 1,3,4-trihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OC2CC(CC(C2O)O)(C(=O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC(=O)OC2CC(CC(C2O)O)(C(=O)O)O)O |
InChI | InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23) |
InChI Key | RAGZUCNPTLULOL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H20O9 |
Molecular Weight | 368.30 g/mol |
Exact Mass | 368.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 154.00 Ų |
XlogP | -0.10 |
1899-29-2 |
PD150836 |
PD156336 |
FT-0778085 |
FT-0778087 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.47% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.39% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.27% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.76% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 91.27% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.93% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.47% | 94.45% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.31% | 94.08% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.72% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.10% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 85.39% | 98.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.98% | 92.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.47% | 90.17% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.96% | 85.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.78% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.35% | 91.19% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.01% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.44% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ageratina tinifolia |
Coffea arabica |
Cussonia arborea |
Eleutherococcus senticosus |
Phellodendron amurense |
Phyllostachys edulis |
Prunus cerasus |
Vaccinium dunalianum |
PubChem | 73210496 |
LOTUS | LTS0008946 |
wikiData | Q104393483 |