5-Hydroxy-7-methyl-tetralin-1,4-dione
| Internal ID | a81452d1-b3aa-4553-8c08-cb8440b11872 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | 5-hydroxy-7-methyl-2,3-dihydronaphthalene-1,4-dione |
| SMILES (Canonical) | CC1=CC2=C(C(=O)CCC2=O)C(=C1)O |
| SMILES (Isomeric) | CC1=CC2=C(C(=O)CCC2=O)C(=C1)O |
| InChI | InChI=1S/C11H10O3/c1-6-4-7-8(12)2-3-9(13)11(7)10(14)5-6/h4-5,14H,2-3H2,1H3 |
| InChI Key | KZQCBBYGLMOAMI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 1.70 |
| AKOS022176100 |
| 5-hydroxy-7-methyl-tetralin-1,4-dione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.03% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.60% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.17% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.65% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.16% | 90.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.69% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.97% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.59% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.73% | 93.03% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.16% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.81% | 89.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.95% | 96.21% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.44% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cynodon dactylon |
| Diospyros argentea |
| Diospyros hebecarpa |
| Diospyros kaki |
| Diospyros virginiana |
| Euclea divinorum |
| Euclea natalensis |
| Nepenthes gracilis |
| PubChem | 16072923 |
| LOTUS | LTS0165030 |
| wikiData | Q105153244 |