(2R)-2-phenyl-2-[(4S,5S)-3,4,5-trihydroxy-6-[[(3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyacetonitrile
Internal ID | 6d06e4c5-0e8e-4efa-a0ed-fc9f37bcf2d2 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Cyanogenic glycosides |
IUPAC Name | (2R)-2-phenyl-2-[(4S,5S)-3,4,5-trihydroxy-6-[[(3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyacetonitrile |
SMILES (Canonical) | C1=CC=C(C=C1)C(C#N)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)[C@H](C#N)OC2C([C@H]([C@@H](C(O2)COC3[C@@H](C([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
InChI | InChI=1S/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)30-20-18(28)16(26)14(24)12(32-20)8-29-19-17(27)15(25)13(23)11(7-22)31-19/h1-5,10-20,22-28H,7-8H2/t10-,11+,12?,13+,14+,15?,16-,17+,18?,19?,20?/m0/s1 |
InChI Key | XUCIJNAGGSZNQT-MUXXRXLQSA-N |
Popularity | 650 references in papers |
Molecular Formula | C20H27NO11 |
Molecular Weight | 457.40 g/mol |
Exact Mass | 457.15841068 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | -2.70 |
29883-15-6 |
BCP28269 |
![2D Structure of (2R)-2-phenyl-2-[(4S,5S)-3,4,5-trihydroxy-6-[[(3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyacetonitrile 2D Structure of (2R)-2-phenyl-2-[(4S,5S)-3,4,5-trihydroxy-6-[[(3R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyacetonitrile](https://plantaedb.com/storage/docs/compounds/2023/11/46ec9980-8617-11ee-b9c3-fb1c176f9e42.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.86% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.46% | 90.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.59% | 94.62% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.39% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.73% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.93% | 95.93% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 89.10% | 94.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.00% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.68% | 94.73% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.98% | 94.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.46% | 86.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.90% | 95.83% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.43% | 86.92% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.23% | 95.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 80.12% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gerbera jamesonii |
Oxyanthus pyriformis |
Passiflora edulis |
Prunus armeniaca |
Prunus cerasus |
Prunus persica |
Prunus salicina |
Prunus spinosa |
PubChem | 134694146 |
LOTUS | LTS0091377 |
wikiData | Q104251825 |