[3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-phenylprop-2-enoate
Internal ID | 43f076b2-ccda-4aef-8220-87be7103b6fe |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters > O-cinnamoyl glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-phenylprop-2-enoate |
SMILES (Canonical) | C1=CC=C(C=C1)C=CC(=O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)C=CC(=O)OC2C(C(C(C(O2)CO)O)O)O |
InChI | InChI=1S/C15H18O7/c16-8-10-12(18)13(19)14(20)15(21-10)22-11(17)7-6-9-4-2-1-3-5-9/h1-7,10,12-16,18-20H,8H2 |
InChI Key | CJGRGYBLAHPYOM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H18O7 |
Molecular Weight | 310.30 g/mol |
Exact Mass | 310.10525291 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 0.10 |
CHEBI:182791 |
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-phenylprop-2-enoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.01% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.98% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.67% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.97% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.47% | 96.09% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.30% | 94.23% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.51% | 94.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.51% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.23% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.39% | 95.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.67% | 94.08% |
CHEMBL2581 | P07339 | Cathepsin D | 83.33% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.25% | 90.17% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.08% | 88.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.94% | 89.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.60% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Balanophora fungosa |
Fragaria × ananassa |
Ligustrum vulgare |
Psidium guajava |
Spiraea thunbergii |
PubChem | 3340171 |
LOTUS | LTS0233142 |
wikiData | Q104961060 |