3-(4-Hydroxyphenyl)prop-2-enal
Internal ID | 95dc7e36-7903-46c6-bdb3-d3d80de8dfb0 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamaldehydes |
IUPAC Name | 3-(4-hydroxyphenyl)prop-2-enal |
SMILES (Canonical) | C1=CC(=CC=C1C=CC=O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC=O)O |
InChI | InChI=1S/C9H8O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-7,11H |
InChI Key | CJXMVKYNVIGQBS-UHFFFAOYSA-N |
Popularity | 38 references in papers |
Molecular Formula | C9H8O2 |
Molecular Weight | 148.16 g/mol |
Exact Mass | 148.052429494 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 1.80 |
2-Propenal, 3-(4-hydroxyphenyl)- |
p-hydroxylcinnamaldehyde |
Spectrum2_001963 |
SPBio_002085 |
CHEBI:181650 |
DTXSID201313650 |
AKOS017404930 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.93% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.45% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 89.89% | 90.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.75% | 98.35% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.45% | 91.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.17% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.44% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia galanga |
Aralia bipinnata |
Broussonetia papyrifera |
Carya cathayensis |
Chamaecyparis formosensis |
Cucurbita maxima |
Sarcophyte sanguinea |
Spiraea formosana |
Zanthoxylum ailanthoides |
PubChem | 440733 |
LOTUS | LTS0148306 |
wikiData | Q104961846 |