(2S)-2-amino-5-hydroxy-5-oxopentanoate;hydron
Internal ID | 81776222-c105-48f3-9400-f757847cfa58 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamic acid and derivatives |
IUPAC Name | (2S)-2-amino-5-hydroxy-5-oxopentanoate;hydron |
SMILES (Canonical) | [H+].C(CC(=O)O)C(C(=O)[O-])N |
SMILES (Isomeric) | [H+].C(CC(=O)O)[C@@H](C(=O)[O-])N |
InChI | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
InChI Key | WHUUTDBJXJRKMK-VKHMYHEASA-N |
Popularity | 195 references in papers |
Molecular Formula | C5H9NO4 |
Molecular Weight | 147.13 g/mol |
Exact Mass | 147.05315777 g/mol |
Topological Polar Surface Area (TPSA) | 103.00 Ų |
XlogP | 0.00 |
Atomic LogP (AlogP) | -1.96 |
H-Bond Acceptor | 4 |
H-Bond Donor | 2 |
Rotatable Bonds | 4 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6947 | 69.47% |
Caco-2 | - | 0.9559 | 95.59% |
Blood Brain Barrier | + | 0.7000 | 70.00% |
Human oral bioavailability | + | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.4336 | 43.36% |
OATP2B1 inhibitior | - | 0.8408 | 84.08% |
OATP1B1 inhibitior | + | 0.9588 | 95.88% |
OATP1B3 inhibitior | + | 0.9529 | 95.29% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | - | 0.9798 | 97.98% |
P-glycoprotein inhibitior | - | 0.9922 | 99.22% |
P-glycoprotein substrate | - | 0.9813 | 98.13% |
CYP3A4 substrate | - | 0.7413 | 74.13% |
CYP2C9 substrate | - | 0.6055 | 60.55% |
CYP2D6 substrate | - | 0.8246 | 82.46% |
CYP3A4 inhibition | - | 0.9594 | 95.94% |
CYP2C9 inhibition | - | 0.9718 | 97.18% |
CYP2C19 inhibition | - | 0.9706 | 97.06% |
CYP2D6 inhibition | - | 0.9568 | 95.68% |
CYP1A2 inhibition | - | 0.9212 | 92.12% |
CYP2C8 inhibition | - | 0.9867 | 98.67% |
CYP inhibitory promiscuity | - | 0.9968 | 99.68% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.7900 | 79.00% |
Carcinogenicity (trinary) | Non-required | 0.6814 | 68.14% |
Eye corrosion | - | 0.9719 | 97.19% |
Eye irritation | - | 0.6519 | 65.19% |
Skin irritation | - | 0.8444 | 84.44% |
Skin corrosion | + | 0.6494 | 64.94% |
Ames mutagenesis | - | 0.8400 | 84.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8297 | 82.97% |
Micronuclear | - | 0.5800 | 58.00% |
Hepatotoxicity | + | 0.7449 | 74.49% |
skin sensitisation | - | 0.9692 | 96.92% |
Respiratory toxicity | + | 0.5667 | 56.67% |
Reproductive toxicity | - | 0.7556 | 75.56% |
Mitochondrial toxicity | - | 0.6500 | 65.00% |
Nephrotoxicity | - | 0.8170 | 81.70% |
Acute Oral Toxicity (c) | III | 0.5440 | 54.40% |
Estrogen receptor binding | - | 0.9521 | 95.21% |
Androgen receptor binding | - | 0.8831 | 88.31% |
Thyroid receptor binding | - | 0.9090 | 90.90% |
Glucocorticoid receptor binding | - | 0.7400 | 74.00% |
Aromatase binding | - | 0.9217 | 92.17% |
PPAR gamma | - | 0.8830 | 88.30% |
Honey bee toxicity | - | 0.9428 | 94.28% |
Biodegradation | + | 0.9500 | 95.00% |
Crustacea aquatic toxicity | - | 0.8700 | 87.00% |
Fish aquatic toxicity | - | 0.9360 | 93.60% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
613 nM |
IC50 |
PMID: 16250647
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
39810.72 nM |
AC50 |
via CMAUP
|
CHEMBL2721 | P43005 | Excitatory amino acid transporter 3 |
51 nM |
Ki |
PMID: 18578477
|
CHEMBL1918 | P39086 | Glutamate receptor ionotropic kainate 1 |
701 nM 701 nM |
Ki Ki |
PMID: 10969973
PMID: 10821708 |
CHEMBL3683 | Q13002 | Glutamate receptor ionotropic kainate 2 |
1106 nM 1106 nM |
Ki Ki |
PMID: 10821708
PMID: 10969973 |
CHEMBL3684 | Q13003 | Glutamate receptor ionotropic kainate 3 |
789 nM 789 nM |
Ki Ki |
PMID: 10821708
PMID: 10969973 |
CHEMBL2675 | Q16478 | Glutamate receptor ionotropic kainate 5 |
750 nM 750 nM |
Ki Ki |
PMID: 10821708
PMID: 10969973 |
CHEMBL2009 | P42261 | Glutamate receptor ionotropic, AMPA 1 |
22000 nM 2260 nM 71000 nM |
EC50 EC50 EC50 |
PMID: 20096591
PMID: 20096591 PMID: 17672447 |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 |
940 nM 940 nM 940 nM |
Ki Ki Ki |
PMID: 10821708
PMID: 9357531 PMID: 10969973 |
CHEMBL3190 | P48058 | Glutamate receptor ionotropic, AMPA 4 |
868 nM 868 nM 868 nM |
Ki Ki Ki |
PMID: 10821708
PMID: 9357531 PMID: 10969973 |
CHEMBL3772 | Q13255 | Metabotropic glutamate receptor 1 |
570 nM 1584.89 nM 250 nM |
Ki Ki Ki |
PMID: 19042134
DOI: 10.1039/C1MD00186H PMID: 17725337 |
CHEMBL5137 | Q14416 | Metabotropic glutamate receptor 2 |
4700 nM 8500 nM 290 nM 7400 nM 1800 nM 2575 nM 1827 nM 2351 nM 1767 nM |
EC50 EC50 EC50 EC50 EC50 EC50 EC50 EC50 EC50 |
PMID: 7738999
PMID: 8759641 PMID: 9572889 PMID: 11720869 DOI: 10.1039/C1MD00186H PMID: 26313429 PMID: 26313429 PMID: 26313429 PMID: 26313429 |
CHEMBL2888 | Q14832 | Metabotropic glutamate receptor 3 |
1002 nM 2500 nM 60 nM 5118 nM 1484 nM 4182 nM |
EC50 EC50 EC50 EC50 EC50 EC50 |
PMID: 26313429
PMID: 10397508 DOI: 10.1039/C1MD00186H PMID: 26313429 PMID: 26313429 PMID: 26313429 |
CHEMBL2736 | Q14833 | Metabotropic glutamate receptor 4 |
3235.94 nM 2400 nM 1600 nM 1400 nM |
Ki Ki Ki Ki |
DOI: 10.1039/C1MD00186H
PMID: 17725337 PMID: 12109902 PMID: 19042134 |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 |
4677.35 nM 390 nM 1160 nM |
Ki Ki Ki |
DOI: 10.1039/C1MD00186H
PMID: 17725337 PMID: 19042134 |
CHEMBL3228 | O00222 | Metabotropic glutamate receptor 8 |
5.7 nM |
IC50 |
PMID: 15603952
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.72% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.54% | 96.09% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.63% | 92.29% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.14% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 86.42% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.78% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 82.02% | 90.20% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.37% | 91.19% |
CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 81.02% | 92.26% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.75% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.53% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 88747398 |
NPASS | NPC137958 |
ChEMBL | CHEMBL575060 |