2,4-Dihydroxybenzoic acid
| Internal ID | 66cbf020-bb27-4ae2-a9a6-614991d9c4ca |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Hydroxybenzoic acid derivatives |
| IUPAC Name | 2,4-dihydroxybenzoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1O)O)C(=O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1O)O)C(=O)O |
| InChI | InChI=1S/C7H6O4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H,(H,10,11) |
| InChI Key | UIAFKZKHHVMJGS-UHFFFAOYSA-N |
| Popularity | 584 references in papers |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.02660867 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 1.60 |
| 89-86-1 |
| beta-Resorcylic acid |
| 4-Carboxyresorcinol |
| 4-Hydroxysalicylic acid |
| Benzoic acid, 2,4-dihydroxy- |
| p-Hydroxysalicylic acid |
| beta-Resorcinolic acid |
| 2,4-Dhba |
| RESORCYLIC ACID, BETA |
| .beta.-Resorcylic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
25118.9 nM |
Potency |
via CMAUP
|
| CHEMBL261 | P00915 | Carbonic anhydrase I |
5200 nM |
Ki |
PMID: 22668600
|
| CHEMBL205 | P00918 | Carbonic anhydrase II |
4900 nM |
Ki |
PMID: 22668600
|
| CHEMBL3242 | O43570 | Carbonic anhydrase XII |
7500 nM |
Ki |
PMID: 22668600
|
| CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
7943.3 nM 3162.3 nM 7943.3 nM 3162.3 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3194 | P02766 | Transthyretin | 93.62% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.76% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.08% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.43% | 95.56% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.79% | 94.42% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 84.47% | 95.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.68% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.57% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.28% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.88% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.18% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abelmoschus manihot |
| Butea monosperma |
| Ferula feruloides |
| Olea europaea |
| Pycnandra acuminata |
| Reynoutria multiflora |
| Rhododendron dauricum |
| Toxicodendron vernicifluum |
| PubChem | 1491 |
| NPASS | NPC241089 |
| ChEMBL | CHEMBL328910 |
| LOTUS | LTS0184319 |
| wikiData | Q209206 |