2-(3,4-Dimethoxyphenyl)-7-methoxy-3-methyl-5-prop-1-enyl-2,3-dihydro-1-benzofuran
Internal ID | 19390a77-e3b9-4611-8d18-1a4826863cd1 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(3,4-dimethoxyphenyl)-7-methoxy-3-methyl-5-prop-1-enyl-2,3-dihydro-1-benzofuran |
SMILES (Canonical) | CC=CC1=CC2=C(C(=C1)OC)OC(C2C)C3=CC(=C(C=C3)OC)OC |
SMILES (Isomeric) | CC=CC1=CC2=C(C(=C1)OC)OC(C2C)C3=CC(=C(C=C3)OC)OC |
InChI | InChI=1S/C21H24O4/c1-6-7-14-10-16-13(2)20(25-21(16)19(11-14)24-5)15-8-9-17(22-3)18(12-15)23-4/h6-13,20H,1-5H3 |
InChI Key | ITFKWUHXYCXXFF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H24O4 |
Molecular Weight | 340.40 g/mol |
Exact Mass | 340.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 36.90 Ų |
XlogP | 4.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.41% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.22% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.07% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.24% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.48% | 85.14% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 87.41% | 97.31% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.99% | 91.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.50% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.04% | 89.00% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 83.19% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.98% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.85% | 92.94% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.08% | 94.03% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.27% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.11% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 80.94% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.93% | 97.09% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.03% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Machilus thunbergii |
Magnolia denudata |
Magnolia kachirachirai |
Myristica castaneifolia |
Myristica fragrans |
Nectandra amazonum |
Piper kadsura |
Sesamum indicum |
PubChem | 53934174 |
LOTUS | LTS0225858 |
wikiData | Q105120015 |