2-[2-(3,4-Dihydroxyphenyl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 6d4ae213-7cf4-4741-b7d3-0ceb864978ca |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | 2-[2-(3,4-dihydroxyphenyl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=C(C=C1CCOC2C(C(C(C(O2)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1CCOC2C(C(C(C(O2)CO)O)O)O)O)O |
InChI | InChI=1S/C14H20O8/c15-6-10-11(18)12(19)13(20)14(22-10)21-4-3-7-1-2-8(16)9(17)5-7/h1-2,5,10-20H,3-4,6H2 |
InChI Key | PQQITYGQJLPDFC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H20O8 |
Molecular Weight | 316.30 g/mol |
Exact Mass | 316.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | -0.80 |
CHEBI:167980 |
(-)-3,4-Dihydroxyphenethyl glucoside |
2-[2-(3,4-dihydroxyphenyl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
NCGC00384719-01!2-[2-(3,4-dihydroxyphenyl)ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.02% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.28% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.64% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.14% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 87.81% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 87.20% | 98.95% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.92% | 94.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.64% | 94.45% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.34% | 96.37% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.06% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.87% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.75% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.28% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.86% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 13845930 |
LOTUS | LTS0163631 |
wikiData | Q105213359 |