1,3-Dihydroxypropan-2-yl 3,8-diacetyloxyicosanoate
Internal ID | 8d570050-5605-4633-995e-b310123dd02f |
Taxonomy | Lipids and lipid-like molecules > Endocannabinoids |
IUPAC Name | 1,3-dihydroxypropan-2-yl 3,8-diacetyloxyicosanoate |
SMILES (Canonical) | CCCCCCCCCCCCC(CCCCC(CC(=O)OC(CO)CO)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CCCCCCCCCCCCC(CCCCC(CC(=O)OC(CO)CO)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C27H50O8/c1-4-5-6-7-8-9-10-11-12-13-16-24(33-22(2)30)17-14-15-18-25(34-23(3)31)19-27(32)35-26(20-28)21-29/h24-26,28-29H,4-21H2,1-3H3 |
InChI Key | OGTGBUDOTUFPPH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H50O8 |
Molecular Weight | 502.70 g/mol |
Exact Mass | 502.35056855 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 6.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.23% | 97.29% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.91% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.90% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.79% | 98.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.52% | 92.86% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.37% | 97.21% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.11% | 93.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.00% | 96.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.49% | 92.08% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.24% | 91.81% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.64% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.11% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.89% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.91% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.08% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 163021367 |
LOTUS | LTS0141759 |
wikiData | Q76010308 |