1-Hydroxypinoresinol 1-O-glucoside
Internal ID | 00e4eef6-f750-4243-82a0-6e23646d34f8 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[[(3R,3aS,6S,6aR)-3,6-bis(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2C3COC(C3(CO2)OC4C(C(C(C(O4)CO)O)O)O)C5=CC(=C(C=C5)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@@H]2[C@H]3CO[C@@H]([C@]3(CO2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C5=CC(=C(C=C5)O)OC)O |
InChI | InChI=1S/C26H32O12/c1-33-17-7-12(3-5-15(17)28)23-14-10-35-24(13-4-6-16(29)18(8-13)34-2)26(14,11-36-23)38-25-22(32)21(31)20(30)19(9-27)37-25/h3-8,14,19-25,27-32H,9-11H2,1-2H3/t14-,19-,20-,21+,22-,23-,24-,25+,26-/m1/s1 |
InChI Key | DRAPQDCEBKBPQE-ACFZRETJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H32O12 |
Molecular Weight | 536.50 g/mol |
Exact Mass | 536.18937645 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | -0.40 |
(2S,3R,4S,5S,6R)-2-[[(3R,3aS,6S,6aR)-3,6-bis(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
CHEMBL517863 |
AKOS040760888 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.69% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.86% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.49% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.28% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.35% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.83% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.82% | 94.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.01% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 86.99% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.50% | 91.49% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.66% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.38% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.41% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.30% | 86.92% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.76% | 97.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.65% | 97.36% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.28% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.09% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.67% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.44% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.37% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bauhinia tarapotensis |
Olea europaea subsp. cuspidata |
Osmanthus fragrans |
Salvia officinalis |
Scorzonera humilis |
Stauntonia hexaphylla |
Tragopogon pratensis |
PubChem | 13995449 |
LOTUS | LTS0108989 |
wikiData | Q104667853 |