(+/-)-Isocorypalmine
Internal ID | 93798592-ebce-420d-96fc-645ea9b40911 |
Taxonomy | Alkaloids and derivatives > Protoberberine alkaloids and derivatives |
IUPAC Name | 3,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-ol |
SMILES (Canonical) | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
SMILES (Isomeric) | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)OC |
InChI | InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-17(22)19(24-2)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3 |
InChI Key | KDFKJOFJHSVROC-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C20H23NO4 |
Molecular Weight | 341.40 g/mol |
Exact Mass | 341.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 2.90 |
Atomic LogP (AlogP) | 3.07 |
H-Bond Acceptor | 5 |
H-Bond Donor | 1 |
Rotatable Bonds | 3 |
Isocorypalmine, DL- |
(R,S)-Isocorypalmine |
DL-Tetrahydrocolumbamine |
Isocorypalmine, (+/-)- |
(R,S)-Tetrahydrocolumbamine |
Isocorypalmine DL-form [MI] |
UNII-YHT108XMMM |
YHT108XMMM |
(+/-)-Alkaloid L from corydalis |
6487-33-8 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8890 | 88.90% |
Caco-2 | + | 0.8811 | 88.11% |
Blood Brain Barrier | + | 0.6500 | 65.00% |
Human oral bioavailability | - | 0.7714 | 77.14% |
Subcellular localzation | Mitochondria | 0.7579 | 75.79% |
OATP2B1 inhibitior | - | 0.8603 | 86.03% |
OATP1B1 inhibitior | + | 0.9486 | 94.86% |
OATP1B3 inhibitior | + | 0.9473 | 94.73% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | + | 0.6500 | 65.00% |
BSEP inhibitior | - | 0.4645 | 46.45% |
P-glycoprotein inhibitior | - | 0.5091 | 50.91% |
P-glycoprotein substrate | + | 0.5222 | 52.22% |
CYP3A4 substrate | + | 0.6028 | 60.28% |
CYP2C9 substrate | + | 0.7825 | 78.25% |
CYP2D6 substrate | + | 0.8432 | 84.32% |
CYP3A4 inhibition | - | 0.7114 | 71.14% |
CYP2C9 inhibition | - | 0.9355 | 93.55% |
CYP2C19 inhibition | - | 0.6180 | 61.80% |
CYP2D6 inhibition | + | 0.7861 | 78.61% |
CYP1A2 inhibition | - | 0.5387 | 53.87% |
CYP2C8 inhibition | - | 0.5634 | 56.34% |
CYP inhibitory promiscuity | - | 0.8688 | 86.88% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6496 | 64.96% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.9688 | 96.88% |
Skin irritation | - | 0.7672 | 76.72% |
Skin corrosion | - | 0.9465 | 94.65% |
Ames mutagenesis | - | 0.6300 | 63.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7110 | 71.10% |
Micronuclear | - | 0.5400 | 54.00% |
Hepatotoxicity | - | 0.7375 | 73.75% |
skin sensitisation | - | 0.8958 | 89.58% |
Respiratory toxicity | + | 0.8556 | 85.56% |
Reproductive toxicity | + | 0.8000 | 80.00% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.7562 | 75.62% |
Acute Oral Toxicity (c) | III | 0.5128 | 51.28% |
Estrogen receptor binding | + | 0.6027 | 60.27% |
Androgen receptor binding | - | 0.5000 | 50.00% |
Thyroid receptor binding | + | 0.6125 | 61.25% |
Glucocorticoid receptor binding | + | 0.6754 | 67.54% |
Aromatase binding | - | 0.7461 | 74.61% |
PPAR gamma | + | 0.5388 | 53.88% |
Honey bee toxicity | - | 0.9005 | 90.05% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6251 | 62.51% |
Fish aquatic toxicity | - | 0.4576 | 45.76% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2056 | P21728 | Dopamine D1 receptor |
15 nM 4.5 nM 15 nM 6.6 nM |
Ki Ki Ki Ki |
PMID: 27032890
via Super-PRED via Super-PRED via Super-PRED |
CHEMBL217 | P14416 | Dopamine D2 receptor |
102 nM 105 nM 41.8 nM 102 nM |
Ki Ki Ki Ki |
via Super-PRED
via Super-PRED via Super-PRED PMID: 27032890 |
CHEMBL234 | P35462 | Dopamine D3 receptor |
37 nM 37 nM 37.3 nM |
Ki Ki Ki |
PMID: 27032890
via Super-PRED via Super-PRED |
CHEMBL219 | P21917 | Dopamine D4 receptor |
77.4 nM |
Ki |
via Super-PRED
|
CHEMBL1850 | P21918 | Dopamine D5 receptor |
9.5 nM |
Ki |
via Super-PRED
|
CHEMBL287 | Q99720 | Sigma opioid receptor |
106 nM 106 nM |
Ki Ki |
PMID: 27032890
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.20% | 93.40% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.57% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.26% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.82% | 94.45% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.57% | 91.79% |
CHEMBL2535 | P11166 | Glucose transporter | 91.38% | 98.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.10% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.55% | 89.62% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.53% | 88.48% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.07% | 95.56% |
CHEMBL5747 | Q92793 | CREB-binding protein | 88.05% | 95.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.98% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 86.54% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.74% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.52% | 95.89% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.17% | 82.38% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.87% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.44% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.77% | 99.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.30% | 100.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.27% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10220 |
NPASS | NPC295691 |
ChEMBL | CHEMBL3780481 |
LOTUS | LTS0043045 |
wikiData | Q27294528 |