Zincophorin
Internal ID | 9a3806eb-069b-40f5-a94d-18ba69fa83de |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | (2S)-2-[(2S,5S,6S)-5-methyl-6-[(2S,3S,4S,5S,6S,7R,10E,12R,13R,14E,16R)-3,5,7,13-tetrahydroxy-4,6,12,14,16-pentamethylnonadeca-10,14-dien-2-yl]oxan-2-yl]propanoic acid |
SMILES (Canonical) | CCCC(C)C=C(C)C(C(C)C=CCCC(C(C)C(C(C)C(C(C)C1C(CCC(O1)C(C)C(=O)O)C)O)O)O)O |
SMILES (Isomeric) | CCC[C@@H](C)/C=C(\C)/[C@@H]([C@H](C)/C=C/CC[C@H]([C@H](C)[C@@H]([C@H](C)[C@@H]([C@H](C)[C@@H]1[C@H](CC[C@H](O1)[C@H](C)C(=O)O)C)O)O)O)O |
InChI | InChI=1S/C33H60O7/c1-10-13-19(2)18-22(5)29(35)20(3)14-11-12-15-27(34)23(6)30(36)25(8)31(37)26(9)32-21(4)16-17-28(40-32)24(7)33(38)39/h11,14,18-21,23-32,34-37H,10,12-13,15-17H2,1-9H3,(H,38,39)/b14-11+,22-18+/t19-,20-,21+,23+,24+,25+,26+,27-,28+,29-,30+,31+,32+/m1/s1 |
InChI Key | XMCIULDTDFJACK-FXLACHKASA-N |
Popularity | 20 references in papers |
Molecular Formula | C33H60O7 |
Molecular Weight | 568.80 g/mol |
Exact Mass | 568.43390425 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 6.70 |
CHEBI:141377 |
DTXSID201043918 |
(2S)-2-[(2S,5S,6S)-5-methyl-6-[(2S,3S,4S,5S,6S,7R,10E,12R,13R,14E,16R)-3,5,7,13-tetrahydroxy-4,6,12,14,16-pentamethylnonadeca-10,14-dien-2-yl]oxan-2-yl]propanoic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.72% | 93.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.40% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.78% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.08% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.94% | 91.19% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.87% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.73% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.21% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.52% | 96.47% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.44% | 95.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.27% | 96.95% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 88.25% | 95.58% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.02% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.78% | 100.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.83% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.75% | 99.23% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.66% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.37% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.25% | 86.33% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.25% | 82.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.49% | 92.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.03% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.