Vitexin-2"-O-rhamnoside
Internal ID | eb31b2e5-3acf-401e-b7a2-187cc90a2dd4 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 8-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2C3=C(C=C(C4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(C(OC2C3=C(C=C(C4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C27H30O14/c1-9-19(33)21(35)23(37)27(38-9)41-26-22(36)20(34)16(8-28)40-25(26)18-13(31)6-12(30)17-14(32)7-15(39-24(17)18)10-2-4-11(29)5-3-10/h2-7,9,16,19-23,25-31,33-37H,8H2,1H3 |
InChI Key | LYGPBZVKGHHTIE-UHFFFAOYSA-N |
Popularity | 29 references in papers |
Molecular Formula | C27H30O14 |
Molecular Weight | 578.50 g/mol |
Exact Mass | 578.16355563 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | -0.90 |
Vitexin 2-O-rhamnoside |
Vitexin-2"-O-rhamnoside |
Apigenin-8-C-glucoside-2'-rhamnoside |
Vitexin-2-rhamnoside |
vitexin-2 inverted exclamation marka-o-rhamnoside |
(?)-N-Boc-N,O-isopropylidene-L-serinal |
A914063 |
(S)-(?)-3-Boc-2,2-dimethyloxazolidine-4-carboxaldehyde |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.17% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.32% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.22% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.76% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.58% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.14% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.54% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.46% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.09% | 86.92% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.09% | 99.15% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 85.59% | 91.38% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.95% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.31% | 91.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.47% | 96.21% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 83.32% | 98.35% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.45% | 97.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.73% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.27% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celtis australis |
Citrus japonica |
Dacrycarpus dacrydioides |
Glycine max |
Machilus japonica |
Turnera diffusa |
PubChem | 5874704 |
LOTUS | LTS0104007 |
wikiData | Q105159306 |