Ueejdiuocucvhn-pwsuyjocsa-
Internal ID | 80f85741-a277-403a-8f60-f3cabce4aedf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (4R)-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethylcyclohex-2-en-1-one |
SMILES (Canonical) | CC1=CC(=O)CC(C1CCC(C)O)(C)C |
SMILES (Isomeric) | CC1=CC(=O)CC([C@H]1CC[C@@H](C)O)(C)C |
InChI | InChI=1S/C13H22O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h7,10,12,14H,5-6,8H2,1-4H3/t10-,12+/m1/s1 |
InChI Key | UEEJDIUOCUCVHN-PWSUYJOCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H22O2 |
Molecular Weight | 210.31 g/mol |
Exact Mass | 210.161979940 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 1.90 |
InChI=1/C13H22O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h7,10,12,14H,5-6,8H2,1-4H3/t10-,12+/m1/s1 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.39% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 96.08% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.99% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.31% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.52% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.32% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.60% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.92% | 97.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.44% | 96.47% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.79% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.25% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia sinensis |
Casearia sylvestris |
Cestrum parqui |
Chenopodium album |
Helianthus annuus |
Laurus nobilis |
Nicotiana tabacum |
Taxus mairei |
Vitis vinifera |
PubChem | 14135400 |
LOTUS | LTS0232551 |
wikiData | Q104375562 |