Triangularine
Internal ID | 00763379-2f66-484b-890e-65c25948696a |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | [(7R,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (Z)-2-(hydroxymethyl)but-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CCN2C1C(=CC2)COC(=O)C(=CC)CO |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@@H]1CCN2[C@@H]1C(=CC2)COC(=O)/C(=C\C)/CO |
InChI | InChI=1S/C18H25NO5/c1-4-12(3)17(21)24-15-7-9-19-8-6-14(16(15)19)11-23-18(22)13(5-2)10-20/h4-6,15-16,20H,7-11H2,1-3H3/b12-4-,13-5-/t15-,16-/m1/s1 |
InChI Key | GOENJWUGVSLZDQ-NCLHDQKXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H25NO5 |
Molecular Weight | 335.40 g/mol |
Exact Mass | 335.17327290 g/mol |
Topological Polar Surface Area (TPSA) | 76.10 Ų |
XlogP | 1.00 |
87340-27-0 |
6-Angelyl-9-sarracinylretronecine |
Y6S2FAL66K |
[(7R,8R)-7-[(Z)-2-methylbut-2-enoyl]oxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (Z)-2-(hydroxymethyl)but-2-enoate |
[(1R,7aR)-1-{[(2Z)-2-methylbut-2-enoyl]oxy}-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl (2Z)-2-(hydroxymethyl)but-2-enoate |
2-Butenoic acid, 2-(hydroxymethyl)-, [(1R,7aR)-2,3,5,7a-tetrahydro-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]-1H-pyrrolizin-7-yl]methyl ester, (2Z)- |
UNII-Y6S2FAL66K |
2-BUTENOIC ACID, 2-(HYDROXYMETHYL)-, ((1R,7AR)-2,3,5,7A-TETRAHYDRO-1-(((2Z)-2-METHYL-1-OXO-2-BUTEN-1-YL)OXY)-1H-PYRROLIZIN-7-YL)METHYL ESTER, (2Z)- |
CHEBI:9672 |
SCHEMBL24102745 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.43% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.70% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.19% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.21% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.10% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.96% | 93.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.77% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.69% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.80% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.80% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.34% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.04% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alkanna orientalis |
Alkanna tinctoria |
Senecio faberi |
Senecio ovatus subsp. stabianus |
Senecio sylvaticus |
Senecio triangularis |
PubChem | 5281755 |
LOTUS | LTS0076174 |
wikiData | Q27108463 |