Testosterone
Internal ID | a818d742-8240-4113-b003-adf07ffc4328 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Androstane steroids > Androgens and derivatives |
IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CC12CCC3C(C1CCC2O)CCC4=CC(=O)CCC34C |
SMILES (Isomeric) | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@]34C |
InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
InChI Key | MUMGGOZAMZWBJJ-DYKIIFRCSA-N |
Popularity | 137,627 references in papers |
Molecular Formula | C19H28O2 |
Molecular Weight | 288.40 g/mol |
Exact Mass | 288.208930132 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 3.30 |
Atomic LogP (AlogP) | 3.88 |
H-Bond Acceptor | 2 |
H-Bond Donor | 1 |
Rotatable Bonds | 0 |
58-22-0 |
Androderm |
Testim |
Testosteron |
Mertestate |
Testoderm |
Virosterone |
Sustanon |
Homosterone |
Androlin |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.8779 | 87.79% |
Blood Brain Barrier | - | 0.5250 | 52.50% |
Human oral bioavailability | - | 0.9000 | 90.00% |
Subcellular localzation | Mitochondria | 0.7307 | 73.07% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9328 | 93.28% |
OATP1B3 inhibitior | + | 0.9834 | 98.34% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | + | 0.7651 | 76.51% |
BSEP inhibitior | + | 0.8147 | 81.47% |
P-glycoprotein inhibitior | + | 0.6194 | 61.94% |
P-glycoprotein substrate | - | 0.9363 | 93.63% |
CYP3A4 substrate | + | 0.7980 | 79.80% |
CYP2C9 substrate | + | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8653 | 86.53% |
CYP3A4 inhibition | - | 0.8812 | 88.12% |
CYP2C9 inhibition | - | 0.9500 | 95.00% |
CYP2C19 inhibition | - | 0.6668 | 66.68% |
CYP2D6 inhibition | - | 0.9452 | 94.52% |
CYP1A2 inhibition | - | 0.9005 | 90.05% |
CYP2C8 inhibition | - | 0.9883 | 98.83% |
CYP inhibitory promiscuity | - | 0.8683 | 86.83% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Warning | 0.4896 | 48.96% |
Eye corrosion | - | 0.9939 | 99.39% |
Eye irritation | - | 0.9830 | 98.30% |
Skin irritation | + | 0.6475 | 64.75% |
Skin corrosion | - | 0.9598 | 95.98% |
Ames mutagenesis | - | 0.9200 | 92.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6161 | 61.61% |
Micronuclear | - | 0.9400 | 94.00% |
Hepatotoxicity | + | 0.9000 | 90.00% |
skin sensitisation | - | 0.5379 | 53.79% |
Respiratory toxicity | + | 0.9889 | 98.89% |
Reproductive toxicity | + | 1.0000 | 100.00% |
Mitochondrial toxicity | + | 0.9875 | 98.75% |
Nephrotoxicity | - | 0.8918 | 89.18% |
Acute Oral Toxicity (c) | III | 0.5718 | 57.18% |
Estrogen receptor binding | + | 0.8997 | 89.97% |
Androgen receptor binding | + | 0.9202 | 92.02% |
Thyroid receptor binding | + | 0.8703 | 87.03% |
Glucocorticoid receptor binding | + | 0.9432 | 94.32% |
Aromatase binding | + | 0.8125 | 81.25% |
PPAR gamma | - | 0.6720 | 67.20% |
Honey bee toxicity | - | 0.8584 | 85.84% |
Biodegradation | - | 0.7500 | 75.00% |
Crustacea aquatic toxicity | + | 0.6700 | 67.00% |
Fish aquatic toxicity | + | 0.9850 | 98.50% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1871 | P10275 | Androgen Receptor |
2.7 nM 4.27 nM 3.9 nM 4.17 nM 2.7 nM 2.7 nM 2.7 nM 4.571 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
via Super-PRED
PMID: 25646649 PMID: 15456242 PMID: 25646649 PMID: 16309907 PMID: 17448656 PMID: 17890084 PMID: 22746350 |
CHEMBL2421 | P08185 | Corticosteroid binding globulin |
190.55 nM |
Ki |
PMID: 15139751
|
CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
600 nM 600 nM |
Ki Ki |
PMID: 6827528
via Super-PRED |
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
10000 nM |
IC50 |
PMID: 14552748
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 |
18300 nM |
EC50 |
PMID: 18307294
|
CHEMBL2034 | P04150 | Glucocorticoid receptor |
3206 nM |
IC50 |
via CMAUP
|
CHEMBL4523454 | Q9H255 | Olfactory receptor 51E2 |
0.69 nM |
EC50 |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
5623.4 nM |
Potency |
via CMAUP
|
CHEMBL287 | Q99720 | Sigma opioid receptor |
1200 nM |
Ki |
PMID: 16033255
|
CHEMBL3305 | P04278 | Testis-specific androgen-binding protein |
14 nM 0.631 nM |
IC50 Kd |
PMID: 17149875
via Super-PRED |
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
31.6 nM 31.6 nM 31.6 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
CHEMBL1940 | Q13936 | Voltage-gated L-type calcium channel alpha-1C subunit |
38.4 nM 34 nM 34 nM |
IC50 IC50 IC50 |
PMID: 22761000
PMID: 22761000 via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 97.25% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.09% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.36% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.67% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.51% | 95.93% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.45% | 94.78% |
CHEMBL2581 | P07339 | Cathepsin D | 84.96% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.45% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.86% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.28% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.90% | 82.69% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.23% | 92.94% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.19% | 90.71% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.16% | 85.30% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Curcuma aromatica |
Lilium lancifolium |
Linum usitatissimum |
Vitex agnus-castus |
PubChem | 6013 |
NPASS | NPC161423 |
ChEMBL | CHEMBL386630 |
LOTUS | LTS0081086 |
wikiData | Q1318776 |