Tamarixetin
Internal ID | 92ce8914-8d66-4b81-a853-6d98f8d3392a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
InChI | InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
InChI Key | FPLMIPQZHHQWHN-UHFFFAOYSA-N |
Popularity | 309 references in papers |
Molecular Formula | C16H12O7 |
Molecular Weight | 316.26 g/mol |
Exact Mass | 316.05830272 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 1.90 |
603-61-2 |
4'-Methoxyquercetin |
4'-O-Methylquercetin |
4'-O-Methyl Quercetin |
Quercetin 4'-methyl ether |
4'-Methylquercetin |
3,3',5,7-Tetrahydroxy-4'-methoxyflavone |
Quercetin, 4'-methyl ether |
UNII-73WRA8Z8M8 |
4H-1-Benzopyran-4-one, 3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)- |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
120 nM |
IC50 |
PMID: 20696580
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
1215 nM |
IC50 |
PMID: 20696580
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
20 nM 20 nM |
IC50 IC50 |
PMID: 20696580
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.71% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.18% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.99% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.98% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.40% | 98.95% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.46% | 96.12% |
CHEMBL3194 | P02766 | Transthyretin | 93.39% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.34% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.53% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.05% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.02% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.68% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.08% | 96.09% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.70% | 98.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.38% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.99% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.11% | 99.23% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 82.96% | 90.20% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.94% | 95.64% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.25% | 93.65% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.12% | 90.71% |
CHEMBL2424 | Q04760 | Glyoxalase I | 81.83% | 91.67% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.95% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281699 |
NPASS | NPC54394 |
ChEMBL | CHEMBL226034 |
LOTUS | LTS0258243 |
wikiData | Q15427839 |