Sylpin
Internal ID | 4ffea763-a158-4cf4-b1bb-e3a207303f75 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
IUPAC Name | 5,6-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-8-methylchromen-4-one |
SMILES (Canonical) | CC1=CC(=C(C2=C1OC(=C(C2=O)OC)C3=CC=C(C=C3)O)O)O |
SMILES (Isomeric) | CC1=CC(=C(C2=C1OC(=C(C2=O)OC)C3=CC=C(C=C3)O)O)O |
InChI | InChI=1S/C17H14O6/c1-8-7-11(19)13(20)12-14(21)17(22-2)16(23-15(8)12)9-3-5-10(18)6-4-9/h3-7,18-20H,1-2H3 |
InChI Key | BUWDKAOCACVEON-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C17H14O6 |
Molecular Weight | 314.29 g/mol |
Exact Mass | 314.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 3.20 |
4',5,6-trihydroxy-3-methoxy-8-methylflavone |
Silpin |
CHEBI:175018 |
DTXSID101145941 |
LMPK12111616 |
5,6-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-8-methylchromen-4-one |
5,6-Dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-8-methyl-4H-1-benzopyran-4-one |
65501-41-9 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.12% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.45% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.85% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.79% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.56% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.01% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.64% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 90.03% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.56% | 95.64% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.60% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 85.21% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.34% | 99.17% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.06% | 93.65% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.49% | 99.23% |
CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 80.21% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 44258710 |
NPASS | NPC116272 |
LOTUS | LTS0088797 |
wikiData | Q104946359 |