Sempervirol
| Internal ID | d1d77473-dbef-4859-96f3-1300c7c71d81 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (4bS,8aS)-4b,8,8-trimethyl-3-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-ol |
| SMILES (Canonical) | CC(C)C1=C(C=C2CCC3C(CCCC3(C2=C1)C)(C)C)O |
| SMILES (Isomeric) | CC(C)C1=C(C=C2CC[C@@H]3[C@@](C2=C1)(CCCC3(C)C)C)O |
| InChI | InChI=1S/C20H30O/c1-13(2)15-12-16-14(11-17(15)21)7-8-18-19(3,4)9-6-10-20(16,18)5/h11-13,18,21H,6-10H2,1-5H3/t18-,20+/m0/s1 |
| InChI Key | RSIJAQZNHHXEJZ-AZUAARDMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.229665576 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 6.70 |
| sempervirol |
| 1857-11-0 |
| (4bS,8aS)-4b,8,8-trimethyl-3-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-ol |
| CHEMBL1097038 |
| SCHEMBL10524412 |
| DTXSID501118720 |
| 17990-27-1 |
| rel-(4bR,8aR)-4b,5,6,7,8,8a,9,10-Octahydro-4b,8,8-trimethyl-3-(1-methylethyl)-2-phenanthrenol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.04% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.76% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.23% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.02% | 94.45% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.96% | 91.79% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.18% | 99.15% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.49% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.45% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.30% | 90.71% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.02% | 97.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.73% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.09% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.46% | 94.75% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.75% | 91.03% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.51% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.44% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.26% | 82.69% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.80% | 99.18% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.58% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.51% | 97.09% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.96% | 98.10% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.38% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chamaecyparis formosensis |
| Cupressus sempervirens |
| Juniperus chinensis |
| Podocarpus neriifolius |
| Salvia multicaulis |
| PubChem | 12442761 |
| LOTUS | LTS0166656 |
| wikiData | Q104402731 |