Resorcinoside A
Internal ID | c8e201c1-f4ec-42d3-8160-7f5cce120f00 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[(3S,4R,12E,14E)-17-(3,5-dihydroxyphenyl)-3-methylheptadeca-12,14-dien-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CCC(C)C(CCCCCCCC=CC=CCCC1=CC(=CC(=C1)O)O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | CC[C@H](C)[C@@H](CCCCCCC/C=C/C=C/CCC1=CC(=CC(=C1)O)O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
InChI | InChI=1S/C30H48O8/c1-3-21(2)25(37-30-29(36)28(35)27(34)26(20-31)38-30)16-14-12-10-8-6-4-5-7-9-11-13-15-22-17-23(32)19-24(33)18-22/h5,7,9,11,17-19,21,25-36H,3-4,6,8,10,12-16,20H2,1-2H3/b7-5+,11-9+/t21-,25+,26+,27+,28-,29+,30-/m0/s1 |
InChI Key | ZWERVKPIXLXNTP-YXDDMCJOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H48O8 |
Molecular Weight | 536.70 g/mol |
Exact Mass | 536.33491849 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | 5.70 |
CHEMBL4449350 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.55% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.71% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.16% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.00% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.98% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.21% | 89.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.14% | 97.29% |
CHEMBL236 | P41143 | Delta opioid receptor | 83.50% | 99.35% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.34% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.29% | 93.56% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.95% | 93.18% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.66% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.31% | 94.75% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.22% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.81% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.69% | 95.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.57% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Caltha palustris |
Cucurbita maxima |
Cytisus scoparius subsp. scoparius |
Diospyros kaki |
PubChem | 145721291 |
LOTUS | LTS0196963 |
wikiData | Q104991605 |