(R)-1,10-Dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol
Internal ID | cae41488-2c9b-4293-ad68-38dff98d6af6 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aR)-1,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)O)OC)O |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC(=C(C=C43)OC)O)OC)O |
InChI | InChI=1S/C19H21NO4/c1-20-5-4-10-7-15(22)19(24-3)18-12-9-16(23-2)14(21)8-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m1/s1 |
InChI Key | LZJRNLRASBVRRX-CYBMUJFWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 62.20 Ų |
XlogP | 2.70 |
Atomic LogP (AlogP) | 2.87 |
H-Bond Acceptor | 5 |
H-Bond Donor | 2 |
Rotatable Bonds | 2 |
55012-01-6 |
NSC-65689 |
NCIStruc1_001364 |
NCIStruc2_001374 |
CHEMBL1437753 |
SCHEMBL13459203 |
NCI65689 |
CCG-36719 |
NCGC00013756 |
NCGC00013756-02 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of (R)-1,10-Dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol 2D Structure of (R)-1,10-Dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol](https://plantaedb.com/storage/docs/compounds/2023/07/r-110-dimethoxy-6-methyl-566a7-tetrahydro-4h-dibenzodegquinoline-29-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8085 | 80.85% |
Caco-2 | + | 0.8546 | 85.46% |
Blood Brain Barrier | + | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.5804 | 58.04% |
OATP2B1 inhibitior | - | 0.8456 | 84.56% |
OATP1B1 inhibitior | + | 0.9300 | 93.00% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.5250 | 52.50% |
BSEP inhibitior | - | 0.4562 | 45.62% |
P-glycoprotein inhibitior | - | 0.9166 | 91.66% |
P-glycoprotein substrate | - | 0.8070 | 80.70% |
CYP3A4 substrate | + | 0.5886 | 58.86% |
CYP2C9 substrate | + | 0.7825 | 78.25% |
CYP2D6 substrate | + | 0.8432 | 84.32% |
CYP3A4 inhibition | - | 0.8593 | 85.93% |
CYP2C9 inhibition | - | 0.9081 | 90.81% |
CYP2C19 inhibition | - | 0.8384 | 83.84% |
CYP2D6 inhibition | + | 0.8931 | 89.31% |
CYP1A2 inhibition | + | 0.9378 | 93.78% |
CYP2C8 inhibition | - | 0.7795 | 77.95% |
CYP inhibitory promiscuity | - | 0.9213 | 92.13% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.7029 | 70.29% |
Eye corrosion | - | 0.9918 | 99.18% |
Eye irritation | - | 0.9207 | 92.07% |
Skin irritation | - | 0.7540 | 75.40% |
Skin corrosion | - | 0.9347 | 93.47% |
Ames mutagenesis | + | 0.6300 | 63.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4173 | 41.73% |
Micronuclear | - | 0.5100 | 51.00% |
Hepatotoxicity | - | 0.7949 | 79.49% |
skin sensitisation | - | 0.8960 | 89.60% |
Respiratory toxicity | + | 0.7778 | 77.78% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.6500 | 65.00% |
Nephrotoxicity | - | 0.8951 | 89.51% |
Acute Oral Toxicity (c) | III | 0.7111 | 71.11% |
Estrogen receptor binding | - | 0.5000 | 50.00% |
Androgen receptor binding | - | 0.5794 | 57.94% |
Thyroid receptor binding | + | 0.5941 | 59.41% |
Glucocorticoid receptor binding | + | 0.8229 | 82.29% |
Aromatase binding | - | 0.5433 | 54.33% |
PPAR gamma | + | 0.7521 | 75.21% |
Honey bee toxicity | - | 0.8975 | 89.75% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.8948 | 89.48% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
3548.1 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
8912.5 nM |
Potency |
via CMAUP
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
3981.07 nM |
AC50 |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
3162.28 nM |
AC50 |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
3981.1 nM 3162.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
5011.9 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
707.9 nM |
Potency |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
316.2 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.05% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 98.02% | 95.62% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 95.75% | 91.79% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.88% | 91.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.84% | 91.11% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 92.82% | 88.48% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.90% | 91.49% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.17% | 91.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.15% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.00% | 95.56% |
CHEMBL5747 | Q92793 | CREB-binding protein | 88.83% | 95.12% |
CHEMBL2581 | P07339 | Cathepsin D | 88.66% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.96% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.18% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 87.11% | 98.75% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.92% | 89.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.02% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.56% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.88% | 86.33% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.80% | 82.38% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.77% | 93.03% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 83.58% | 96.86% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.48% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.16% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.65% | 89.00% |
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 80.06% | 95.70% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Litsea glutinosa |
Neolitsea acuminatissima |
Neolitsea sericea |
Phoebe grandis |
PubChem | 726885 |
NPASS | NPC196447 |
ChEMBL | CHEMBL1437753 |
LOTUS | LTS0117449 |
wikiData | Q105159910 |