Quebrachamine
Internal ID | 52e96980-08dc-40b5-9bf8-e37e1543163b |
Taxonomy | Alkaloids and derivatives > Quebrachamine alkaloids |
IUPAC Name | (15R)-15-ethyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraene |
SMILES (Canonical) | CCC12CCCN(C1)CCC3=C(CC2)NC4=CC=CC=C34 |
SMILES (Isomeric) | CC[C@]12CCCN(C1)CCC3=C(CC2)NC4=CC=CC=C34 |
InChI | InChI=1S/C19H26N2/c1-2-19-10-5-12-21(14-19)13-9-16-15-6-3-4-7-17(15)20-18(16)8-11-19/h3-4,6-7,20H,2,5,8-14H2,1H3/t19-/m1/s1 |
InChI Key | FDNDLNFGITWTOZ-LJQANCHMSA-N |
Popularity | 80 references in papers |
Molecular Formula | C19H26N2 |
Molecular Weight | 282.40 g/mol |
Exact Mass | 282.209598838 g/mol |
Topological Polar Surface Area (TPSA) | 19.00 Ų |
XlogP | 4.30 |
(-)-Quebrachamine |
Quebrachamin |
4850-21-9 |
CHEBI:110 |
7M37I29KEU |
C09235 |
kamassin |
Kamassine |
(15R)-15-ethyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraene |
AC1L3P9D |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.59% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.14% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.95% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.94% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.61% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.22% | 95.56% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.55% | 88.56% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 87.86% | 90.71% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.79% | 90.08% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 87.35% | 98.59% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.58% | 97.25% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.82% | 91.71% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.29% | 97.50% |
CHEMBL2535 | P11166 | Glucose transporter | 82.26% | 98.75% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.86% | 94.75% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 81.83% | 96.42% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.41% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aspidosperma polyneuron |
Aspidosperma quebracho-blanco |
Gonioma kamassi |
Hunteria umbellata |
Kopsia arborea |
Melodinus fusiformis |
Rhazya stricta |
Tabernaemontana grandiflora |
PubChem | 92990 |
LOTUS | LTS0140120 |
wikiData | Q27105240 |