Pterostilbene
Internal ID | 1066b6b4-96ce-479c-add2-f4afde2237d4 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol |
SMILES (Canonical) | COC1=CC(=CC(=C1)C=CC2=CC=C(C=C2)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1)/C=C/C2=CC=C(C=C2)O)OC |
InChI | InChI=1S/C16H16O3/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11,17H,1-2H3/b4-3+ |
InChI Key | VLEUZFDZJKSGMX-ONEGZZNKSA-N |
Popularity | 1,113 references in papers |
Molecular Formula | C16H16O3 |
Molecular Weight | 256.30 g/mol |
Exact Mass | 256.109944368 g/mol |
Topological Polar Surface Area (TPSA) | 38.70 Ų |
XlogP | 3.80 |
Atomic LogP (AlogP) | 3.58 |
H-Bond Acceptor | 3 |
H-Bond Donor | 1 |
Rotatable Bonds | 4 |
537-42-8 |
trans-pterostilbene |
4-(3,5-Dimethoxystyryl)phenol |
(E)-4-(3,5-dimethoxystyryl)phenol |
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenol |
3',5'-Dimethoxy-4-stilbenol |
18259-15-9 |
pterostilbene, (E)- |
4-[(E)-2-(3,5-dimethoxyphenyl)vinyl]phenol |
3,5-Dimethoxy-4'-hydroxy-trans-stilbene |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9965 | 99.65% |
Caco-2 | + | 0.7473 | 74.73% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.8298 | 82.98% |
OATP2B1 inhibitior | - | 0.8570 | 85.70% |
OATP1B1 inhibitior | + | 0.9056 | 90.56% |
OATP1B3 inhibitior | + | 0.9791 | 97.91% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | - | 0.5715 | 57.15% |
P-glycoprotein inhibitior | - | 0.7975 | 79.75% |
P-glycoprotein substrate | - | 0.9728 | 97.28% |
CYP3A4 substrate | - | 0.6573 | 65.73% |
CYP2C9 substrate | - | 0.5963 | 59.63% |
CYP2D6 substrate | - | 0.6581 | 65.81% |
CYP3A4 inhibition | - | 0.5979 | 59.79% |
CYP2C9 inhibition | - | 0.9304 | 93.04% |
CYP2C19 inhibition | + | 0.7583 | 75.83% |
CYP2D6 inhibition | - | 0.9249 | 92.49% |
CYP1A2 inhibition | + | 0.8736 | 87.36% |
CYP2C8 inhibition | + | 0.4775 | 47.75% |
CYP inhibitory promiscuity | + | 0.6700 | 67.00% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.5979 | 59.79% |
Carcinogenicity (trinary) | Non-required | 0.5992 | 59.92% |
Eye corrosion | - | 0.9657 | 96.57% |
Eye irritation | + | 0.9623 | 96.23% |
Skin irritation | - | 0.6780 | 67.80% |
Skin corrosion | - | 0.9724 | 97.24% |
Ames mutagenesis | - | 0.7400 | 74.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6932 | 69.32% |
Micronuclear | - | 0.5500 | 55.00% |
Hepatotoxicity | - | 0.6343 | 63.43% |
skin sensitisation | - | 0.6031 | 60.31% |
Respiratory toxicity | - | 0.9000 | 90.00% |
Reproductive toxicity | + | 0.5556 | 55.56% |
Mitochondrial toxicity | - | 0.8125 | 81.25% |
Nephrotoxicity | + | 0.4634 | 46.34% |
Acute Oral Toxicity (c) | III | 0.6558 | 65.58% |
Estrogen receptor binding | + | 0.8745 | 87.45% |
Androgen receptor binding | + | 0.8175 | 81.75% |
Thyroid receptor binding | + | 0.7715 | 77.15% |
Glucocorticoid receptor binding | + | 0.7489 | 74.89% |
Aromatase binding | + | 0.9173 | 91.73% |
PPAR gamma | + | 0.8325 | 83.25% |
Honey bee toxicity | - | 0.9277 | 92.77% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | + | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.9483 | 94.83% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
530 nM |
IC50 |
via Super-PRED
|
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein |
10000 nM |
IC50 |
PMID: 16686543
|
CHEMBL221 | P23219 | Cyclooxygenase-1 |
700 nM |
IC50 |
PMID: 18487053
|
CHEMBL230 | P35354 | Cyclooxygenase-2 |
820 nM |
IC50 |
PMID: 18487053
|
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
570 nM |
Ki |
DOI: 10.1039/C0MD00242A
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
900 nM 1400 nM |
Ki IC50 |
via Super-PRED
DOI: 10.1039/C3MD00317E |
CHEMBL1741189 | P55789 | FAD-linked sulfhydryl oxidase ALR |
778 nM |
AC50 |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
11220.2 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
2511.9 nM |
Potency |
via CMAUP
|
CHEMBL4302 | P08183 | P-glycoprotein 1 |
42000 nM |
IC50 |
PMID: 16686543
|
CHEMBL3959 | P16083 | Quinone reductase 2 |
5100 nM |
IC50 |
PMID: 23953689
|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
3162.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.87% | 95.56% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 92.73% | 98.35% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.94% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.63% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.41% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.86% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.56% | 90.00% |
CHEMBL2487 | P05067 | Beta amyloid A4 protein | 85.17% | 96.74% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.00% | 93.99% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.89% | 91.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.51% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.49% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.28% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.03% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 5281727 |
NPASS | NPC180508 |
ChEMBL | CHEMBL83527 |
LOTUS | LTS0003132 |
wikiData | Q2908011 |